| Name | Glucosinalbate | ||
| PubChem CID | 145925702 | ||
| Molecular Weight | 423.5g/mol | ||
| Formula | C₁₅H₂₁NO₉S₂ | ||
| SMILES | C1=CC(=CC=C1CC(=NCS(=O)(=O)O)SC2C(C(C(C(O2)CO)O)O)O)O | ||
| InChI | 1S/C15H21NO9S2/c17-6-10-12(19)13(20)14(21)15(25-10)26-11(16-7-27(22,23)24)5-8-1-3-9(18)4-2-8/h1-4,10,12-15,17-21H,5-7H2,(H,22,23,24)/b16-11+/t10-,12-,13+,14-,15+/m1/s1 | ||
| InChIKey | RBAIBQMJGQNYFA-MFIRQCQASA-N | ||
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | NiNanJie | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Brassicales
-->Family: Brassicaceae
-->Genus: Arabidopsis
-->Species: Arabidopsis thaliana
|
||
| Pair Name | Glucosinalbate, Doxorubicin | |||
| Partner Name | Doxorubicin | |||
| Disease Info | [ICD-11: 2C90] | Ehrlich ascites carcinoma | Investigative | |
| Biological Phenomena | Inhibition-->Angiogenesis | |||
| Gene Regulation | Up-regulation | Expression | APAF1 | hsa317 |
| Up-regulation | Expression | BAX | hsa581 | |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Up-regulation | Expression | CASP9 | hsa842 | |
| Up-regulation | Expression | CYCS | hsa54205 | |
| Up-regulation | Expression | GSTP1 | hsa2950 | |
| Up-regulation | Expression | HMOX1 | hsa3162 | |
| Down-regulation | Expression | IL6 | hsa3569 | |
| Down-regulation | Expression | KEAP1 | hsa9817 | |
| Up-regulation | Expression | LBR | hsa3930 | |
| Down-regulation | Expression | MMP9 | hsa4318 | |
| Up-regulation | Expression | NFE2L2 | hsa4780 | |
| Up-regulation | Expression | NFKBIA | hsa4792 | |
| Down-regulation | Expression | NOS2 | hsa4843 | |
| Up-regulation | Expression | NQO1 | hsa1728 | |
| Up-regulation | Cleavage | PARP1 | hsa142 | |
| Down-regulation | Expression | PTGS2 | hsa5743 | |
| Down-regulation | Expression | RELA | hsa5970 | |
| Down-regulation | Expression | VEGFA | hsa7422 | |
| In Vivo Model | Ehrlich ascites carcinoma cell was maintained in Swiss albino mice by weekly intraperitoneal transplantation of 1×10⁶ viable tumor cells suspended in isotonic phosphate-buffered solution (PBS). | |||
| Result | The present study clearly suggested therapeutic benefit of I3C in combination with DOX by augmenting anticancer efficacy and diminishing toxicity to the host. | |||
| No. | Title | Href |
|---|---|---|
| 1 | Indole-3-Carbinol (I3C) enhances the sensitivity of murine breast adenocarcinoma cells to doxorubicin (DOX) through inhibition of NF-κβ, blocking angiogenesis and regulation of mitochondrial apoptotic pathway. Chem Biol Interact. 2018 Jun 25;290:19-36. doi: 10.1016/j.cbi.2018.05.005. | Click |
