9H-Pyrido(3,4-b)indole, 7-methoxy-1-methyl-, Banisterine, Harmine, Leucoharmine, Telepathine, Yageine
| Name | Harmine | ||
| PubChem CID | 5280953 | ||
| Molecular Weight | 212.25g/mol | ||
| Synonyms |
9H-Pyrido(3,4-b)indole, 7-methoxy-1-methyl-, Banisterine, Harmine, Leucoharmine, Telepathine, Yageine |
||
| Formula | C₁₃H₁₂N₂O | ||
| SMILES | CC1=NC=CC2=C1NC3=C2C=CC(=C3)OC | ||
| InChI | 1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 | ||
| InChIKey | BXNJHAXVSOCGBA-UHFFFAOYSA-N | ||
| CAS Number | 442-51-3 | ||
| ChEMBL ID | CHEMBL269538 | ||
| ChEBI ID | CHEBI:28121 | ||
| Herb ID | HBIN028803 | ||
| Drug Bank ID | DB07919 | ||
| KEGG ID | C06538 | ||
| Toxicity | Organism | Test Type | Route(Dose) |
| rat | LD50 | intraperitoneal(165 mg/kg) | |
| mouse | LD50 | intraperitoneal(254 mg/kg) | |
| rat | LD50 | oral(322 mg/kg) | |
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | LuoTuoPeng | ||
| Use Part | Whole herb | ||
| Habitat | NeiMengGu, NingXia, GanSu, XinJiang, XiZang | ||
| Flavor | Sour; Sweet | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Sapindales
-->Family: Nitrariaceae
-->Genus: Peganum
-->Species: Peganum harmala
|
||
| Pair Name | Harmine, Temozolomide | |||
| Partner Name | Temozolomide | |||
| Disease Info | [ICD-11: 2A00] | Glioblastoma multiforme | Investigative | |
| Gene Regulation | Down-regulation | Expression | MMP2 | hsa4313 |
| Down-regulation | Expression | MMP9 | hsa4318 | |
| In Vitro Model | T98G | Glioblastoma | Homo sapiens (Human) | CVCL_0556 |
| Result | Harmine Augments the Cytotoxic and Anti-invasive Potential of Temozolomide Against Glioblastoma Multiforme Cells | |||
| Pair Name | Harmine, Paclitaxel | |||
| Partner Name | Paclitaxel | |||
| Disease Info | [ICD-11: 2B72] | Gastric cancer | Investigative | |
| Biological Phenomena | Induction-->Apoptosis | |||
| Gene Regulation | Up-regulation | Expression | BAX | hsa581 |
| Up-regulation | Expression | BAX | hsa581 | |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Down-regulation | Expression | BIRC5 | hsa332 | |
| Down-regulation | Expression | CDH2 | hsa1000 | |
| Up-regulation | Expression | CDKN1A | hsa1026 | |
| Down-regulation | Expression | COX2 | hsa4513 | |
| Down-regulation | Expression | CTNNB1 | hsa1499 | |
| Down-regulation | Expression | FN1 | hsa2335 | |
| Down-regulation | Expression | NFKB1 | hsa4790 | |
| Down-regulation | Expression | PCNA | hsa5111 | |
| Up-regulation | Expression | ROS1 | hsa6098 | |
| Up-regulation | Expression | SMAD4 | hsa4089 | |
| Down-regulation | Expression | TNF | hsa7124 | |
| Up-regulation | Expression | TP53 | hsa7157 | |
| Down-regulation | Expression | TWIST1 | hsa7291 | |
| In Vitro Model | SGC-7901 | Human papillomavirus-related cervical adenocarcinoma | Homo sapiens (Human) | CVCL_0520 |
| In Vivo Model | The mice were subcutaneously injected into the left axillary space with 0.1 ml of cell suspension containing 4-6×10⁶ SGC-7901 cells. | |||
| Result | Harmine combined with paclitaxel inhibits tumor proliferation and induces apoptosis through down-regulation of cyclooxygenase-2 expression in gastric cancer | |||
| No. | Title | Href |
|---|---|---|
| 1 | Harmine Augments the Cytotoxic and Anti-invasive Potential of Temozolomide Against Glioblastoma Multiforme Cells. Jundishapur J Nat Pharm Prod. 2021. doi:10.5812/jjnpp.115464. | Click |
| 2 | Harmine combined with paclitaxel inhibits tumor proliferation and induces apoptosis through down-regulation of cyclooxygenase-2 expression in gastric cancer. Oncol Lett. 2016 Aug;12(2):983-988. doi: 10.3892/ol.2016.4696. | Click |
