bakuchiol
| Name | Bakuchiol | ||
| PubChem CID | 5468522 | ||
| Molecular Weight | 256.4g/mol | ||
| Synonyms |
bakuchiol |
||
| Formula | C₁₈H₂₄O | ||
| SMILES | CC(=CCCC(C)(C=C)C=CC1=CC=C(C=C1)O)C | ||
| InChI | 1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 | ||
| InChIKey | LFYJSSARVMHQJB-QIXNEVBVSA-N | ||
| CAS Number | 10309-37-2 | ||
| ChEMBL ID | CHEMBL262344 | ||
| Herb ID | HBIN017546 | ||
| Drug Bank ID | DB16102 | ||
| Toxicity | Organism | Test Type | Route(Dose) |
| rat | LD50 | intraperitoneal(165 mg/kg) | |
| mouse | LD50 | intraperitoneal(254 mg/kg) | |
| rat | LD50 | oral(322 mg/kg) | |
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | BuGuZhi | ||
| Use Part | Fruit | ||
| Habitat | HeNan, SiChuan, AnHui | ||
| Flavor | Pungent, Bitter | ||
| Meridian Tropism | Kidney, Spleen | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Fabales
-->Family: Fabaceae
-->Genus: Cullen
-->Species: Cullen corylifolium
|
||
| Pair Name | Bakuchiol, TNF-related apoptosis inducing ligand | |||
| Partner Name | TNF-related apoptosis inducing ligand | |||
| Disease Info | [ICD-11: 2B91.Z] | Colorectal cancer | Investigative | |
| Biological Phenomena | Induction-->Apoptosis | |||
| Gene Regulation | Down-regulation | Expression | BCL2 | hsa596 |
| Down-regulation | Expression | CFLAR | hsa8837 | |
| Down-regulation | Expression | XIAP | hsa331 | |
| Down-regulation | Expression | BIRC5 | hsa332 | |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Up-regulation | Cleavage | CASP8 | hsa841 | |
| Up-regulation | Cleavage | CASP9 | hsa842 | |
| Up-regulation | Cleavage | PARP1 | hsa142 | |
| Up-regulation | Expression | TNFRSF10A | hsa8797 | |
| Up-regulation | Expression | TNFRSF10B | hsa8795 | |
| Up-regulation | Phosphorylation | MAPK8 | hsa5599 | |
| In Vitro Model | HCT 116 | Colon carcinoma | Homo sapiens (Human) | CVCL_0291 |
| HT-29 | Colon adenocarcinoma | Homo sapiens (Human) | CVCL_0320 | |
| Result | The collective results suggest that bakuchiol facilitates TRAIL-induced apoptosis in colon cancer cells through up-regulation of the TRAIL receptors; DR4 and DR5 via ROS/JNK pathway signals. | |||
