zeylenone
| Name | Zeylenone | ||
| PubChem CID | 10571940 | ||
| Molecular Weight | 382.4g/mol | ||
| Synonyms |
zeylenone |
||
| Formula | C₂₁H₁₈O₇ | ||
| SMILES | C1=CC=C(C=C1)C(=O)OCC2(C(C(C=CC2=O)OC(=O)C3=CC=CC=C3)O)O | ||
| InChI | 1S/C21H18O7/c22-17-12-11-16(28-20(25)15-9-5-2-6-10-15)18(23)21(17,26)13-27-19(24)14-7-3-1-4-8-14/h1-12,16,18,23,26H,13H2/t16-,18+,21-/m1/s1 | ||
| InChIKey | UUNZIGRBVXAOSR-PLMTUMEDSA-N | ||
| CAS Number | 193410-84-3 | ||
| ChEMBL ID | CHEMBL4468212 | ||
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | DaHuaZiYuPan | ||
| Use Part | Root and leaf | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Magnoliales
-->Family: Annonaceae
-->Genus: Uvaria
-->Species: Uvaria grandiflora
|
||
| Pair Name | Zeylenone, Cisplatin | |||
| Partner Name | Cisplatin | |||
| Disease Info | [ICD-11: 2B51] | Osteosarcoma | Investigative | |
| Biological Phenomena | Induction-->DNA damage | |||
| Gene Regulation | Down-regulation | Phosphorylation | AKT1 | hsa207 |
| Up-regulation | Expression | BAX | hsa581 | |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Up-regulation | Cleavage | CASP8 | hsa841 | |
| Down-regulation | Expression | CDK2 | hsa1017 | |
| Up-regulation | Expression | CDKN1A | hsa1026 | |
| Up-regulation | Expression | CHEK1 | hsa1111 | |
| Down-regulation | Expression | FANCD2 | hsa2177 | |
| Down-regulation | Expression | FANCI | hsa55215 | |
| Down-regulation | Phosphorylation | GSK3B | hsa2932 | |
| Up-regulation | Expression | H2AX | hsa3014 | |
| Down-regulation | Expression | HSP90AA1 | hsa3320 | |
| Up-regulation | Expression | MLKL | hsa197259 | |
| Up-regulation | Expression | RB1 | hsa5925 | |
| Up-regulation | Expression | RIPK1 | hsa8737 | |
| Up-regulation | Expression | RIPK3 | hsa11035 | |
| Up-regulation | Expression | TP53 | hsa7157 | |
| In Vitro Model | CCRF S-180 II | Mouse fibrosarcoma | Mus musculus (Mouse) | CVCL_2874 |
| HOS | Osteosarcoma | Homo sapiens (Human) | CVCL_0312 | |
| U2OS | Osteosarcoma | Homo sapiens (Human) | CVCL_0042 | |
| In Vivo Model | 5×10⁵ S180 cells wereinjected into the peritoneal cavity of the mice and proliferated to pro-duce ascites. | |||
| Result | Zeylenone synergizes with cisplatin in osteosarcoma by enhancing DNA damage, apoptosis, and necrosis via the Hsp90/AKT/GSK3β and Fanconi anaemia pathway | |||
