10-hydroxycamptothecin, 10-hydroxycamptothecine
| Name | (S)-10-Hydroxycamptothecin | ||
| PubChem CID | 97226 | ||
| Molecular Weight | 364.4g/mol | ||
| Synonyms |
10-hydroxycamptothecin, 10-hydroxycamptothecine |
||
| Formula | C₂₀H₁₆N₂O₅ | ||
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=CC5=C4)O)O | ||
| InChI | 1S/C20H16N2O5/c1-2-20(26)14-7-16-17-11(5-10-6-12(23)3-4-15(10)21-17)8-22(16)18(24)13(14)9-27-19(20)25/h3-7,23,26H,2,8-9H2,1H3/t20-/m0/s1 | ||
| InChIKey | HAWSQZCWOQZXHI-FQEVSTJZSA-N | ||
| CAS Number | 19685-09-7 | ||
| ChEMBL ID | CHEMBL273862 | ||
| ChEBI ID | CHEBI:81395 | ||
| Drug Bank ID | DB12385 | ||
| KEGG ID | C17939 | ||
| Toxicity | Organism | Test Type | Route(Dose) |
| rat | LD50 | intraperitoneal(165 mg/kg) | |
| mouse | LD50 | intraperitoneal(254 mg/kg) | |
| rat | LD50 | oral(322 mg/kg) | |
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | XiShu | ||
| Use Part | fruit or root | ||
| Habitat | JiangXi, ZheJiang, HuNan, HuBei, SiChuan, YunNan, GuiZhou, GuangXi, GuangDong | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Cornales
-->Family: Nyssaceae
-->Genus: Camptotheca
-->Species: Camptotheca acuminata
|
||
| Pair Name | (S)-10-Hydroxycamptothecin, Crizotinib | |||
| Partner Name | Crizotinib | |||
| Disease Info | [ICD-11: 2C25.Z] | Lung cancer | Investigative | |
| Gene Regulation | Up-regulation | Expression | CYCS | hsa54205 |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Up-regulation | Expression | BAX | hsa581 | |
| Down-regulation | Expression | BCL-xL | hsa598 | |
| Down-regulation | Phosphorylation | AKT1 | hsa207 | |
| Down-regulation | Phosphorylation | MAPK8 | hsa5599 | |
| Down-regulation | Phosphorylation | MAPK1 | hsa5594 | |
| Up-regulation | Phosphorylation | MAPK14 | hsa1432 | |
| Down-regulation | Phosphorylation | EGFR | hsa1956 | |
| In Vitro Model | NCI-H1975 | Lung adenocarcinoma | Homo sapiens (Human) | CVCL_1511 |
| HCC827 | Lung adenocarcinoma | Homo sapiens (Human) | CVCL_2063 | |
| NCI-H460 | Lung large cell carcinoma | Homo sapiens (Human) | CVCL_0459 | |
| Result | Development of 10-Hydroxycamptothecin-crizotinib conjugate based on the synergistic effect on lung cancer cells | |||
