hispidin
| Name | Hispidin | ||
| PubChem CID | 54685921 | ||
| Molecular Weight | 246.21g/mol | ||
| Synonyms |
hispidin |
||
| Formula | C₁₃H₁₀O₅ | ||
| SMILES | C1=CC(=C(C=C1C=CC2=CC(=CC(=O)O2)O)O)O | ||
| InChI | 1S/C13H10O5/c14-9-6-10(18-13(17)7-9)3-1-8-2-4-11(15)12(16)5-8/h1-7,14-16H/b3-1+ | ||
| InChIKey | SGJNQVTUYXCBKH-HNQUOIGGSA-N | ||
| CAS Number | 555-55-5 | ||
| ChEMBL ID | CHEMBL1224512 | ||
| ChEBI ID | CHEBI:36332 | ||
| Herb ID | HBIN029426 | ||
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | SangHuang | ||
| Use Part | Sporocarp | ||
| Habitat | BeiJing, TianJin, HeBei, ShanXi, NeiMengGu, Shaanxi, GanSu, QingHai, NingXia, XinJiang, HeiLongJiang, JiLin, TaiWan, GuangDong, SiChuan, YunNan, XiZang | ||
| Species |
>Kingdom: Fungi
-->Phylum: Eumycophyta
-->Class: Hymenomycetes
-->Order: Polyporales
-->Family: Polyporaceae
-->Genus: Phellinus
-->Species: Phellinus igniarius
|
||
| Pair Name | Hispidin, Gemcitabine | |||
| Partner Name | Gemcitabine | |||
| Disease Info | [ICD-11: 2C10] | Pancreatic cancer | Investigative | |
| Gene Regulation | Down-regulation | Expression | BCL2 | hsa596 |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Down-regulation | Expression | CD44 | hsa960 | |
| Down-regulation | Expression | NANOG | hsa79923 | |
| Down-regulation | Expression | NFKB1 | hsa4790 | |
| Up-regulation | Cleavage | PARP1 | hsa142 | |
| Down-regulation | Expression | SOX2 | hsa6657 | |
| Down-regulation | Expression | TP53 | hsa7157 | |
| In Vitro Model | BxPC-3 | Pancreatic ductal adenocarcinoma | Homo sapiens (Human) | CVCL_0186 |
| AsPC-1 | Pancreatic ductal adenocarcinoma | Homo sapiens (Human) | CVCL_0152 | |
| Result | Hispidin might be a novel chemosensitizer for gemcitabine and a potential synergistic agent for increasing the therapeutic index of gemcitabine as a treatment for pancreatic cancer. | |||
