curcumenol
| Name | Curcumenol | ||
| PubChem CID | 167812 | ||
| Molecular Weight | 234.33g/mol | ||
| Synonyms |
curcumenol |
||
| Formula | C₁₅H₂₂O₂ | ||
| SMILES | CC1CCC2C13CC(=C(C)C)C(O3)(C=C2C)O | ||
| InChI | 1S/C15H22O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h7,11-12,16H,5-6,8H2,1-4H3/t11-,12-,14-,15+/m0/s1 | ||
| InChIKey | ISFMXVMWEWLJGJ-NZBPQXDJSA-N | ||
| CAS Number | 19431-84-6 | ||
| Herb ID | HBIN021979 | ||
| Toxicity | Organism | Test Type | Route(Dose) |
| rat | LD50 | intraperitoneal(165 mg/kg) | |
| mouse | LD50 | intraperitoneal(254 mg/kg) | |
| rat | LD50 | oral(322 mg/kg) | |
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | EZhu | ||
| Flavor | Pungent; bitter | ||
| Meridian Tropism | Liver; Spleen | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Zingiberales
-->Family: Zingiberaceae
-->Genus: Curcuma
-->Species: Curcuma zedoaria
|
||
| Pair Name | Curcumenol, Cisplatin | |||
| Partner Name | Cisplatin | |||
| Disease Info | [ICD-11: 2C77.Z] | Cervical cancer | Investigative | |
| Biological Phenomena | Induction-->Apoptosis | |||
| Gene Regulation | Down-regulation | Expression | HIF1A | hsa3091 |
| Down-regulation | Expression | YWHAG | hsa7532 | |
| Down-regulation | Expression | MMP2 | hsa4313 | |
| Down-regulation | Expression | MMP9 | hsa4318 | |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Up-regulation | Expression | PARP1 | hsa142 | |
| Up-regulation | Expression | CASP3 | hsa836 | |
| In Vitro Model | HeLa | Human papillomavirus-related cervical adenocarcinoma | Homo sapiens (Human) | CVCL_0030 |
| C-33 A | Human papillomavirus-independent cervical squamous cell carcinoma | Homo sapiens (Human) | CVCL_1094 | |
| Result | Curcumenol can enhance cisplatin to inhibit cancer cell proliferation, migration, and invasion and promote tumor cell apoptosis. The combination of drugs may promote the apoptosis of cervical cancer cells through the YWHAG pathway. | |||
