![]() |
Name |
Actinoallolide E
|
Molecular Formula | C32H50O7 | |
IUPAC Name* |
(5R,6R,7R)-14-ethyl-7-hydroxy-5-[(2R,6S,7R,8S)-7-hydroxy-4,6,8-trimethyl-9-oxoundec-4-en-2-yl]-6,10,12-trimethyl-4,15-dioxabicyclo[10.2.1]pentadeca-1(14),9-diene-3,13-dione
|
|
SMILES |
CCC1=C2CC(=O)O[C@@H]([C@@H]([C@@H](CC=C(CC(C1=O)(O2)C)C)O)C)[C@H](C)CC(=C[C@H](C)[C@H]([C@H](C)C(=O)CC)O)C
|
|
InChI |
InChI=1S/C32H50O7/c1-10-24-27-16-28(35)38-30(21(6)15-19(4)14-20(5)29(36)22(7)25(33)11-2)23(8)26(34)13-12-18(3)17-32(9,39-27)31(24)37/h12,14,20-23,26,29-30,34,36H,10-11,13,15-17H2,1-9H3/t20-,21+,22+,23+,26+,29+,30+,32?/m0/s1
|
|
InChIKey |
VGSMDJWAWJALKD-GFCNXCJQSA-N
|
|
Synonyms |
Actinoallolide E
|
|
CAS | NA | |
PubChem CID | 156580365 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 546.7 | ALogp: | 5.3 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 110.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 39 | QED Weighted: | 0.278 |
Caco-2 Permeability: | -4.687 | MDCK Permeability: | 0.00002550 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.954 |
Human Intestinal Absorption (HIA): | 0.178 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.474 |
Blood-Brain-Barrier Penetration (BBB): | 0.036 | Plasma Protein Binding (PPB): | 93.39% |
Volume Distribution (VD): | 1.93 | Fu: | 3.95% |
CYP1A2-inhibitor: | 0.023 | CYP1A2-substrate: | 0.172 |
CYP2C19-inhibitor: | 0.051 | CYP2C19-substrate: | 0.903 |
CYP2C9-inhibitor: | 0.089 | CYP2C9-substrate: | 0.096 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.036 |
CYP3A4-inhibitor: | 0.863 | CYP3A4-substrate: | 0.724 |
Clearance (CL): | 9.843 | Half-life (T1/2): | 0.34 |
hERG Blockers: | 0.063 | Human Hepatotoxicity (H-HT): | 0.983 |
Drug-inuced Liver Injury (DILI): | 0.907 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.862 | Maximum Recommended Daily Dose: | 0.323 |
Skin Sensitization: | 0.049 | Carcinogencity: | 0.101 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.274 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004260 | ![]() |
0.746 | D06LNW | ![]() |
0.209 | ||
ENC004259 | ![]() |
0.609 | D0Z4UN | ![]() |
0.209 | ||
ENC004257 | ![]() |
0.541 | D05AFC | ![]() |
0.206 | ||
ENC004261 | ![]() |
0.434 | D05CHI | ![]() |
0.202 | ||
ENC002888 | ![]() |
0.290 | D0WY9N | ![]() |
0.201 | ||
ENC002887 | ![]() |
0.290 | D0W2EK | ![]() |
0.201 | ||
ENC003155 | ![]() |
0.279 | D0H2MO | ![]() |
0.200 | ||
ENC000943 | ![]() |
0.267 | D0Y7LD | ![]() |
0.200 | ||
ENC002889 | ![]() |
0.264 | D0X1WJ | ![]() |
0.199 | ||
ENC003489 | ![]() |
0.263 | D0L6QI | ![]() |
0.198 |