|
Name |
Dothideomycetide A
|
| Molecular Formula | C25H34O7 | |
| IUPAC Name* |
[(3S,8R)-1,9-dihydroxy-1,3,8-trimethyl-2,4-dioxo-5,6,7,8-tetrahydrophenanthren-3-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethylhexanoate
|
|
| SMILES |
CC[C@H](C)[C@H]([C@@H](C)C(=O)O[C@]1(C(=O)C2=C3CCC[C@H](C3=C(C=C2C(C1=O)(C)O)O)C)C)O
|
|
| InChI |
InChI=1S/C25H34O7/c1-7-12(2)20(27)14(4)22(29)32-25(6)21(28)19-15-10-8-9-13(3)18(15)17(26)11-16(19)24(5,31)23(25)30/h11-14,20,26-27,31H,7-10H2,1-6H3/t12-,13+,14+,20+,24?,25-/m0/s1
|
|
| InChIKey |
PHZTWQVIBIBVMW-KMDRFBGRSA-N
|
|
| Synonyms |
Dothideomycetide A; CHEMBL3358711; [(3S,8R)-1,9-dihydroxy-1,3,8-trimethyl-2,4-dioxo-5,6,7,8-tetrahydrophenanthren-3-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethyl-hexanoate
|
|
| CAS | NA | |
| PubChem CID | 66560383 | |
| ChEMBL ID | CHEMBL3358711 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 446.5 | ALogp: | 4.1 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 121.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 32 | QED Weighted: | 0.463 |
| Caco-2 Permeability: | -4.786 | MDCK Permeability: | 0.00001550 |
| Pgp-inhibitor: | 0.872 | Pgp-substrate: | 0.955 |
| Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.047 |
| 30% Bioavailability (F30%): | 0.079 |
| Blood-Brain-Barrier Penetration (BBB): | 0.693 | Plasma Protein Binding (PPB): | 93.68% |
| Volume Distribution (VD): | 1.247 | Fu: | 7.87% |
| CYP1A2-inhibitor: | 0.066 | CYP1A2-substrate: | 0.923 |
| CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.877 |
| CYP2C9-inhibitor: | 0.109 | CYP2C9-substrate: | 0.164 |
| CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.071 |
| CYP3A4-inhibitor: | 0.853 | CYP3A4-substrate: | 0.913 |
| Clearance (CL): | 3.158 | Half-life (T1/2): | 0.126 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.321 |
| Drug-inuced Liver Injury (DILI): | 0.948 | AMES Toxicity: | 0.094 |
| Rat Oral Acute Toxicity: | 0.21 | Maximum Recommended Daily Dose: | 0.949 |
| Skin Sensitization: | 0.207 | Carcinogencity: | 0.432 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
| Respiratory Toxicity: | 0.919 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004897 | ![]() |
0.466 | D01CKY | ![]() |
0.264 | ||
| ENC004896 | ![]() |
0.393 | D05AFR | ![]() |
0.238 | ||
| ENC002888 | ![]() |
0.388 | D08NQZ | ![]() |
0.235 | ||
| ENC002887 | ![]() |
0.388 | D0L7AS | ![]() |
0.234 | ||
| ENC002329 | ![]() |
0.350 | D08LTU | ![]() |
0.230 | ||
| ENC002328 | ![]() |
0.350 | D0WY9N | ![]() |
0.229 | ||
| ENC004251 | ![]() |
0.321 | D0T5XN | ![]() |
0.227 | ||
| ENC003006 | ![]() |
0.301 | D0I5DS | ![]() |
0.227 | ||
| ENC005367 | ![]() |
0.295 | D0R6RC | ![]() |
0.223 | ||
| ENC002386 | ![]() |
0.290 | D0J2NK | ![]() |
0.223 | ||