![]() |
Name |
Actinoallolide C
|
Molecular Formula | C32H50O7 | |
IUPAC Name* |
(5R)-5-[(2R,3R,4R,8S,9R,10S)-3,9-dihydroxy-4,6,8,10-tetramethyl-11-oxotridec-6-en-2-yl]-12-ethyl-8,10-dimethyl-4,13-dioxabicyclo[8.2.1]trideca-1(12),7-diene-3,11-dione
|
|
SMILES |
CCC1=C2CC(=O)O[C@H](CC=C(CC(C1=O)(O2)C)C)[C@H](C)[C@@H]([C@H](C)CC(=C[C@H](C)[C@H]([C@H](C)C(=O)CC)O)C)O
|
|
InChI |
InChI=1S/C32H50O7/c1-10-24-27-16-28(34)38-26(13-12-18(3)17-32(9,39-27)31(24)37)23(8)30(36)21(6)15-19(4)14-20(5)29(35)22(7)25(33)11-2/h12,14,20-23,26,29-30,35-36H,10-11,13,15-17H2,1-9H3/t20-,21+,22+,23-,26+,29+,30+,32?/m0/s1
|
|
InChIKey |
JJBKBNZVPPRXII-KJKTYCSFSA-N
|
|
Synonyms |
Actinoallolide C
|
|
CAS | NA | |
PubChem CID | 156580496 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 546.7 | ALogp: | 5.3 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 110.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 39 | QED Weighted: | 0.249 |
Caco-2 Permeability: | -4.763 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.944 |
Human Intestinal Absorption (HIA): | 0.126 | 20% Bioavailability (F20%): | 0.334 |
30% Bioavailability (F30%): | 0.875 |
Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 88.25% |
Volume Distribution (VD): | 1.304 | Fu: | 5.02% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.077 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.702 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.053 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.035 |
CYP3A4-inhibitor: | 0.835 | CYP3A4-substrate: | 0.636 |
Clearance (CL): | 7.84 | Half-life (T1/2): | 0.409 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.973 |
Drug-inuced Liver Injury (DILI): | 0.934 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.634 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.104 | Carcinogencity: | 0.141 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.089 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004259 | ![]() |
0.823 | D0WY9N | ![]() |
0.201 | ||
ENC004255 | ![]() |
0.746 | D06LNW | ![]() |
0.199 | ||
ENC004257 | ![]() |
0.719 | D03KIA | ![]() |
0.193 | ||
ENC004261 | ![]() |
0.588 | D0L5FY | ![]() |
0.184 | ||
ENC003822 | ![]() |
0.276 | D03SVX | ![]() |
0.183 | ||
ENC002777 | ![]() |
0.270 | D0H2MO | ![]() |
0.179 | ||
ENC003821 | ![]() |
0.269 | D0X1WJ | ![]() |
0.177 | ||
ENC002889 | ![]() |
0.264 | D05AFC | ![]() |
0.176 | ||
ENC003155 | ![]() |
0.263 | D00FSV | ![]() |
0.176 | ||
ENC005126 | ![]() |
0.260 | D05CHI | ![]() |
0.175 |