| 
                    Name | 
                         Dothideomycetone A 
                     | 
                
| Molecular Formula | C25H40O7 | |
| IUPAC Name* | 
                         [(1S,6S)-6-hydroxy-3-[2-[(1S,2S,6R)-2-hydroxy-6-methylcyclohexyl]-2-oxoethyl]-4,6-dimethyl-5-oxocyclohex-3-en-1-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethylhexanoate 
                     | 
                |
| SMILES | 
                         CC[C@H](C)[C@H]([C@@H](C)C(=O)O[C@H]1CC(=C(C(=O)[C@@]1(C)O)C)CC(=O)[C@H]2[C@@H](CCC[C@@H]2O)C)O 
                     | 
                |
| InChI | 
                         InChI=1S/C25H40O7/c1-7-13(2)22(28)16(5)24(30)32-20-12-17(15(4)23(29)25(20,6)31)11-19(27)21-14(3)9-8-10-18(21)26/h13-14,16,18,20-22,26,28,31H,7-12H2,1-6H3/t13-,14+,16+,18-,20-,21-,22+,25-/m0/s1 
                     | 
                |
| InChIKey | 
                         YRAPWMYACXYABW-ZEXAJZPYSA-N 
                     | 
                |
| Synonyms | 
                         Dothideomycetone A; CHEMBL3358710; [(1S,6S)-6-hydroxy-3-[2-[(1S,2S,6R)-2-hydroxy-6-methyl-cyclohexyl]-2-oxo-ethyl]-4,6-dimethyl-5-oxo-cyclohex-3-en-1-yl] (2R,3R,4S)-3-hydroxy-2,4-dimethyl-hexanoate 
                     | 
                |
| CAS | NA | |
| PubChem CID | 66560297 | |
| ChEMBL ID | CHEMBL3358710 | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 452.6 | ALogp: | 3.0 | 
| HBD: | 3 | HBA: | 7 | 
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 121.0 | Aromatic Rings: | 2 | 
| Heavy Atoms: | 32 | QED Weighted: | 0.482 | 
| Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00005540 | 
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.996 | 
| Human Intestinal Absorption (HIA): | 0.401 | 20% Bioavailability (F20%): | 0.761 | 
| 30% Bioavailability (F30%): | 0.539 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.279 | Plasma Protein Binding (PPB): | 72.05% | 
| Volume Distribution (VD): | 1.08 | Fu: | 18.42% | 
| CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.223 | 
| CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.801 | 
| CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.077 | 
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.032 | 
| CYP3A4-inhibitor: | 0.765 | CYP3A4-substrate: | 0.445 | 
| Clearance (CL): | 8.676 | Half-life (T1/2): | 0.177 | 
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.404 | 
| Drug-inuced Liver Injury (DILI): | 0.92 | AMES Toxicity: | 0.012 | 
| Rat Oral Acute Toxicity: | 0.849 | Maximum Recommended Daily Dose: | 0.087 | 
| Skin Sensitization: | 0.129 | Carcinogencity: | 0.698 | 
| Eye Corrosion: | 0.027 | Eye Irritation: | 0.023 | 
| Respiratory Toxicity: | 0.983 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002888 | ![]()  | 
                    1.000 | D08SVH | ![]()  | 
                    0.248 | ||
| ENC002889 | ![]()  | 
                    0.388 | D05RXI | ![]()  | 
                    0.246 | ||
| ENC004897 | ![]()  | 
                    0.371 | D02RQU | ![]()  | 
                    0.241 | ||
| ENC004896 | ![]()  | 
                    0.318 | D0E9KA | ![]()  | 
                    0.239 | ||
| ENC003895 | ![]()  | 
                    0.295 | D0X7XG | ![]()  | 
                    0.236 | ||
| ENC002822 | ![]()  | 
                    0.290 | D06WTZ | ![]()  | 
                    0.233 | ||
| ENC004255 | ![]()  | 
                    0.290 | D03SXE | ![]()  | 
                    0.231 | ||
| ENC004128 | ![]()  | 
                    0.287 | D03KYG | ![]()  | 
                    0.230 | ||
| ENC004127 | ![]()  | 
                    0.287 | D0K7HU | ![]()  | 
                    0.229 | ||
| ENC000943 | ![]()  | 
                    0.285 | D0X6GN | ![]()  | 
                    0.229 | ||