|
Name |
Actinoallolide A
|
| Molecular Formula | C32H52O8 | |
| IUPAC Name* |
(5R,12R)-5-[(2R,3R,4R,8S,9R,10S)-3,9-dihydroxy-4,6,8,10-tetramethyl-11-oxotridec-6-en-2-yl]-12-ethyl-1-hydroxy-8,10-dimethyl-4,13-dioxabicyclo[8.2.1]tridec-7-ene-3,11-dione
|
|
| SMILES |
CC[C@@H]1C(=O)C2(CC(=CC[C@@H](OC(=O)CC1(O2)O)[C@H](C)[C@@H]([C@H](C)CC(=C[C@H](C)[C@H]([C@H](C)C(=O)CC)O)C)O)C)C
|
|
| InChI |
InChI=1S/C32H52O8/c1-10-24-30(37)31(9)16-18(3)12-13-26(39-27(34)17-32(24,38)40-31)23(8)29(36)21(6)15-19(4)14-20(5)28(35)22(7)25(33)11-2/h12,14,20-24,26,28-29,35-36,38H,10-11,13,15-17H2,1-9H3/t20-,21+,22+,23-,24+,26+,28+,29+,31?,32?/m0/s1
|
|
| InChIKey |
HGDVFZDJXDLEKR-SFAJNDLDSA-N
|
|
| Synonyms |
Actinoallolide A
|
|
| CAS | NA | |
| PubChem CID | 156580437 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 564.7 | ALogp: | 4.3 |
| HBD: | 3 | HBA: | 8 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 130.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 40 | QED Weighted: | 0.233 |
| Caco-2 Permeability: | -4.696 | MDCK Permeability: | 0.00001370 |
| Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.956 |
| Human Intestinal Absorption (HIA): | 0.366 | 20% Bioavailability (F20%): | 0.196 |
| 30% Bioavailability (F30%): | 0.601 |
| Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 92.08% |
| Volume Distribution (VD): | 1.052 | Fu: | 4.61% |
| CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.101 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.846 |
| CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.083 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.054 |
| CYP3A4-inhibitor: | 0.62 | CYP3A4-substrate: | 0.677 |
| Clearance (CL): | 13.506 | Half-life (T1/2): | 0.62 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.93 |
| Drug-inuced Liver Injury (DILI): | 0.918 | AMES Toxicity: | 0.038 |
| Rat Oral Acute Toxicity: | 0.956 | Maximum Recommended Daily Dose: | 0.022 |
| Skin Sensitization: | 0.046 | Carcinogencity: | 0.103 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.049 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004261 | ![]() |
0.826 | D0H2MO | ![]() |
0.205 | ||
| ENC004260 | ![]() |
0.719 | D0E9KA | ![]() |
0.199 | ||
| ENC004259 | ![]() |
0.600 | D06LNW | ![]() |
0.198 | ||
| ENC004255 | ![]() |
0.541 | D0X1WJ | ![]() |
0.192 | ||
| ENC003822 | ![]() |
0.273 | D0E4SI | ![]() |
0.189 | ||
| ENC002887 | ![]() |
0.268 | D0J7OG | ![]() |
0.188 | ||
| ENC002888 | ![]() |
0.268 | D0W2EK | ![]() |
0.185 | ||
| ENC003155 | ![]() |
0.268 | D0G6AB | ![]() |
0.184 | ||
| ENC003821 | ![]() |
0.266 | D0WY9N | ![]() |
0.184 | ||
| ENC002777 | ![]() |
0.266 | D03KIA | ![]() |
0.183 | ||