![]() |
Name |
Cochlioquinone A
|
Molecular Formula | C30H44O8 | |
IUPAC Name* |
[(2S,3R,4S)-2-[(3R,4aR,6aR,12S,12aS,12bR)-12-hydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-8,11-dioxo-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]-4-methylhexan-3-yl] acetate
|
|
SMILES |
CC[C@H](C)[C@H]([C@@H](C)C1=CC(=O)C2=C(C1=O)O[C@@]3(CC[C@@H]4[C@@]([C@H]3[C@@H]2O)(CC[C@@H](O4)C(C)(C)O)C)C)OC(=O)C
|
|
InChI |
InChI=1S/C30H44O8/c1-9-15(2)25(36-17(4)31)16(3)18-14-19(32)22-24(34)27-29(7)12-10-20(28(5,6)35)37-21(29)11-13-30(27,8)38-26(22)23(18)33/h14-16,20-21,24-25,27,34-35H,9-13H2,1-8H3/t15-,16-,20+,21+,24+,25+,27+,29-,30+/m0/s1
|
|
InChIKey |
UWSYUCZPPVXEKW-MHUJPXPPSA-N
|
|
Synonyms |
Cochlioquinone A; 32450-25-2; [(2S,3R,4S)-2-[(3R,4aR,6aR,12S,12aS,12bR)-12-hydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-8,11-dioxo-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]-4-methylhexan-3-yl] acetate; CochlioquinoneA; Coclioquinone A; CHEMBL2288168; CHEBI:177074; DTXSID501346549; BDBM50529935; ZINC85639587
|
|
CAS | 32450-25-2 | |
PubChem CID | 161747 | |
ChEMBL ID | CHEMBL2288168 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 532.7 | ALogp: | 3.4 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 119.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 38 | QED Weighted: | 0.379 |
Caco-2 Permeability: | -4.795 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0.949 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.045 |
Blood-Brain-Barrier Penetration (BBB): | 0.289 | Plasma Protein Binding (PPB): | 99.26% |
Volume Distribution (VD): | 0.731 | Fu: | 3.58% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.233 |
CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.542 |
CYP2C9-inhibitor: | 0.272 | CYP2C9-substrate: | 0.333 |
CYP2D6-inhibitor: | 0.398 | CYP2D6-substrate: | 0.143 |
CYP3A4-inhibitor: | 0.682 | CYP3A4-substrate: | 0.5 |
Clearance (CL): | 1.991 | Half-life (T1/2): | 0.104 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.847 |
Drug-inuced Liver Injury (DILI): | 0.629 | AMES Toxicity: | 0.041 |
Rat Oral Acute Toxicity: | 0.897 | Maximum Recommended Daily Dose: | 0.807 |
Skin Sensitization: | 0.166 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.04 |
Respiratory Toxicity: | 0.577 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001862 | ![]() |
0.788 | D0W5LS | ![]() |
0.262 | ||
ENC002674 | ![]() |
0.780 | D02CJX | ![]() |
0.248 | ||
ENC004571 | ![]() |
0.717 | D0Y7LD | ![]() |
0.243 | ||
ENC004573 | ![]() |
0.678 | D0W2EK | ![]() |
0.242 | ||
ENC004251 | ![]() |
0.616 | D0X4RS | ![]() |
0.241 | ||
ENC004572 | ![]() |
0.613 | D09WYX | ![]() |
0.235 | ||
ENC003489 | ![]() |
0.613 | D0X7XG | ![]() |
0.235 | ||
ENC002182 | ![]() |
0.613 | D04SFH | ![]() |
0.234 | ||
ENC004570 | ![]() |
0.605 | D0Q4SD | ![]() |
0.233 | ||
ENC003638 | ![]() |
0.600 | D0H2MO | ![]() |
0.233 |