![]() |
Name |
Oxohygrolidin
|
Molecular Formula | C34H54O7 | |
IUPAC Name* |
(3E,5E,7R,8S,9S,11E,13E,15S,16R)-16-[(E,2S,3R,4S,8R,9R)-3,9-dihydroxy-4,8-dimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one
|
|
SMILES |
CC[C@H]([C@H](C)/C=C/C(=O)[C@@H](C)[C@@H]([C@H](C)[C@@H]1[C@H](/C=C/C=C(/C[C@@H]([C@@H]([C@@H](/C=C(/C=C(/C(=O)O1)\C)\C)C)O)C)\C)OC)O)O
|
|
InChI |
InChI=1S/C34H54O7/c1-11-28(35)22(4)15-16-29(36)26(8)32(38)27(9)33-30(40-10)14-12-13-20(2)17-23(5)31(37)24(6)18-21(3)19-25(7)34(39)41-33/h12-16,18-19,22-24,26-28,30-33,35,37-38H,11,17H2,1-10H3/b14-12+,16-15+,20-13+,21-18+,25-19+/t22-,23+,24-,26-,27+,28-,30+,31+,32+,33-/m1/s1
|
|
InChIKey |
HBTGJJXCZRLXJW-YMGFNHCLSA-N
|
|
Synonyms |
Oxohygrolidin; 98813-11-7; (3E,5E,7R,8S,9S,11E,13E,15S,16R)-16-[(E,2S,3R,4S,8R,9R)-3,9-dihydroxy-4,8-dimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one
|
|
CAS | NA | |
PubChem CID | 101421469 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 574.8 | ALogp: | 5.6 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 113.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 41 | QED Weighted: | 0.239 |
Caco-2 Permeability: | -4.736 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.993 |
Human Intestinal Absorption (HIA): | 0.833 | 20% Bioavailability (F20%): | 0.41 |
30% Bioavailability (F30%): | 0.727 |
Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 92.75% |
Volume Distribution (VD): | 2.376 | Fu: | 4.41% |
CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.571 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.902 |
CYP2C9-inhibitor: | 0.186 | CYP2C9-substrate: | 0.442 |
CYP2D6-inhibitor: | 0.095 | CYP2D6-substrate: | 0.673 |
CYP3A4-inhibitor: | 0.936 | CYP3A4-substrate: | 0.479 |
Clearance (CL): | 8.294 | Half-life (T1/2): | 0.333 |
hERG Blockers: | 0.266 | Human Hepatotoxicity (H-HT): | 0.966 |
Drug-inuced Liver Injury (DILI): | 0.578 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.116 | Maximum Recommended Daily Dose: | 0.891 |
Skin Sensitization: | 0.537 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.665 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002304 | ![]() |
0.344 | D07DIM | ![]() |
0.275 | ||
ENC003821 | ![]() |
0.298 | D0FX2Q | ![]() |
0.255 | ||
ENC003822 | ![]() |
0.283 | D05CHI | ![]() |
0.252 | ||
ENC004259 | ![]() |
0.279 | D0G3DL | ![]() |
0.242 | ||
ENC004255 | ![]() |
0.279 | D04ITO | ![]() |
0.242 | ||
ENC004261 | ![]() |
0.275 | D06LNW | ![]() |
0.240 | ||
ENC004257 | ![]() |
0.268 | D09YHJ | ![]() |
0.239 | ||
ENC004260 | ![]() |
0.263 | D06WTZ | ![]() |
0.237 | ||
ENC004229 | ![]() |
0.257 | D02RQU | ![]() |
0.227 | ||
ENC002888 | ![]() |
0.255 | D0G9IU | ![]() |
0.223 |