|
Name |
trichomerol
|
| Molecular Formula | C28H34O8 | |
| IUPAC Name* |
1,8-dihydroxy-4,12-bis(1-hydroxyhexa-2,4-dienylidene)-2,6,9,10-tetramethyl-7,14-dioxatetracyclo[6.5.1.02,6.010,13]tetradecane-3,11-dione
|
|
| SMILES |
CC=CC=CC(O)=C1CC2(C)OC3(O)C(C)C(=O)C(=C(O)C=CC=CC)C4C3(C)OC2(O)C4(C)C1=O
|
|
| InChI |
InChI=1S/C28H34O8/c1-7-9-11-13-18(29)17-15-24(4)28(34)25(5,23(17)32)22-20(19(30)14-12-10-8-2)21(31)16(3)27(33,35-24)26(22,6)36-28/h7-14,16,22,29-30,33-34H,15H2,1-6H3/b9-7+,10-8+,13-11+,14-12+,18-17-,20-19+/t16-,22-,24+,25-,26+,27-,28+/m1/s1
|
|
| InChIKey |
DNBQGIWSAOMTJS-ZKXPZSNVSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 498.57 | ALogp: | 3.6 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 133.5 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.255 |
| Caco-2 Permeability: | -4.981 | MDCK Permeability: | 0.00001580 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.014 |
| Human Intestinal Absorption (HIA): | 0.211 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.062 |
| Blood-Brain-Barrier Penetration (BBB): | 0.887 | Plasma Protein Binding (PPB): | 82.27% |
| Volume Distribution (VD): | 2.4 | Fu: | 4.67% |
| CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.939 |
| CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.868 |
| CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.013 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.119 |
| CYP3A4-inhibitor: | 0.261 | CYP3A4-substrate: | 0.939 |
| Clearance (CL): | 8.623 | Half-life (T1/2): | 0.146 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.101 |
| Drug-inuced Liver Injury (DILI): | 0.943 | AMES Toxicity: | 0.254 |
| Rat Oral Acute Toxicity: | 0.925 | Maximum Recommended Daily Dose: | 0.949 |
| Skin Sensitization: | 0.824 | Carcinogencity: | 0.85 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.95 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003709 | ![]() |
0.712 | D0FG6M | ![]() |
0.222 | ||
| ENC004472 | ![]() |
0.655 | D0E9KA | ![]() |
0.195 | ||
| ENC003887 | ![]() |
0.565 | D0H2MO | ![]() |
0.194 | ||
| ENC003128 | ![]() |
0.516 | D02DGU | ![]() |
0.192 | ||
| ENC003500 | ![]() |
0.504 | D0G3PI | ![]() |
0.192 | ||
| ENC003762 | ![]() |
0.500 | D00DKK | ![]() |
0.192 | ||
| ENC003886 | ![]() |
0.492 | D0G6AB | ![]() |
0.188 | ||
| ENC003250 | ![]() |
0.447 | D0MY8N | ![]() |
0.184 | ||
| ENC002144 | ![]() |
0.419 | D0S7WX | ![]() |
0.177 | ||
| ENC003579 | ![]() |
0.364 | D05QDC | ![]() |
0.176 | ||