|
Name |
Saturnispol B
|
| Molecular Formula | C28H34O9 | |
| IUPAC Name* |
(4S,4aR,5aS,9aR,9bR)-9-[(2E,4E)-1,6-dihydroxyhexa-2,4-dienylidene]-4,4a,8-trihydroxy-2-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-3,9a-dihydrodibenzofuran-1,6-dione
|
|
| SMILES |
C/C=C/C=C/C(=C1C[C@]([C@]2([C@@](C1=O)([C@H]3C(=C(/C=C/C=C/CO)O)C(=C(C(=O)[C@]3(O2)C)C)O)C)O)(C)O)O
|
|
| InChI |
InChI=1S/C28H34O9/c1-6-7-9-12-18(30)17-15-25(3,35)28(36)26(4,24(17)34)22-20(19(31)13-10-8-11-14-29)21(32)16(2)23(33)27(22,5)37-28/h6-13,22,29-32,35-36H,14-15H2,1-5H3/b7-6+,11-8+,12-9+,13-10+,18-17?,20-19?/t22-,25+,26-,27+,28+/m1/s1
|
|
| InChIKey |
ZQLXNVBKDCXOIW-GQZMFSPWSA-N
|
|
| Synonyms |
Saturnispol B
|
|
| CAS | NA | |
| PubChem CID | 139590667 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 514.6 | ALogp: | 1.8 |
| HBD: | 6 | HBA: | 9 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 165.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 37 | QED Weighted: | 0.181 |
| Caco-2 Permeability: | -5.088 | MDCK Permeability: | 0.00001650 |
| Pgp-inhibitor: | 0.991 | Pgp-substrate: | 0.837 |
| Human Intestinal Absorption (HIA): | 0.029 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.849 | Plasma Protein Binding (PPB): | 59.18% |
| Volume Distribution (VD): | 0.982 | Fu: | 25.98% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.918 |
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.58 |
| CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.014 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.04 |
| CYP3A4-inhibitor: | 0.306 | CYP3A4-substrate: | 0.918 |
| Clearance (CL): | 4.941 | Half-life (T1/2): | 0.251 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.058 |
| Drug-inuced Liver Injury (DILI): | 0.627 | AMES Toxicity: | 0.094 |
| Rat Oral Acute Toxicity: | 0.469 | Maximum Recommended Daily Dose: | 0.944 |
| Skin Sensitization: | 0.766 | Carcinogencity: | 0.905 |
| Eye Corrosion: | 0.314 | Eye Irritation: | 0.066 |
| Respiratory Toxicity: | 0.972 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003886 | ![]() |
0.877 | D0FG6M | ![]() |
0.212 | ||
| ENC003500 | ![]() |
0.608 | D0S7WX | ![]() |
0.211 | ||
| ENC002144 | ![]() |
0.585 | D02GAC | ![]() |
0.203 | ||
| ENC005987 | ![]() |
0.565 | D02DGU | ![]() |
0.198 | ||
| ENC004472 | ![]() |
0.504 | D00DKK | ![]() |
0.198 | ||
| ENC003709 | ![]() |
0.500 | D0G3PI | ![]() |
0.198 | ||
| ENC003250 | ![]() |
0.440 | D0E9KA | ![]() |
0.192 | ||
| ENC003762 | ![]() |
0.416 | D08NQZ | ![]() |
0.190 | ||
| ENC003579 | ![]() |
0.399 | D0J2NK | ![]() |
0.187 | ||
| ENC003128 | ![]() |
0.399 | D0R6RC | ![]() |
0.187 | ||