|
Name |
(4S,4aR,5aS,9E,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione
|
| Molecular Formula | C28H34O9 | |
| IUPAC Name* |
(4S,4aR,5aS,9E,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione
|
|
| SMILES |
C/C=C/CCC(=O)C1=C([C@]2([C@H]3/C(=C(/C=C/C=C/C)\O)/C(=C(C(=O)[C@]3(O[C@]2([C@@](C1=O)(C)O)O)C)C)O)C)O
|
|
| InChI |
InChI=1S/C28H34O9/c1-7-9-11-13-16(29)18-20(31)15(3)22(32)26(5)21(18)25(4)23(33)19(17(30)14-12-10-8-2)24(34)27(6,35)28(25,36)37-26/h7-11,13,21,29,31,33,35-36H,12,14H2,1-6H3/b9-7+,10-8+,13-11+,18-16-/t21-,25-,26+,27+,28-/m1/s1
|
|
| InChIKey |
WQBJMULJHJGKBM-UWHOGNIDSA-N
|
|
| Synonyms |
Dihydrobisvertinolone
|
|
| CAS | NA | |
| PubChem CID | 11409703 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 514.6 | ALogp: | 2.6 |
| HBD: | 5 | HBA: | 9 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 162.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 37 | QED Weighted: | 0.151 |
| Caco-2 Permeability: | -5.332 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.314 | Pgp-substrate: | 0.96 |
| Human Intestinal Absorption (HIA): | 0.056 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.097 | Plasma Protein Binding (PPB): | 86.82% |
| Volume Distribution (VD): | 0.908 | Fu: | 9.41% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.614 |
| CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.741 |
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.011 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.039 |
| CYP3A4-inhibitor: | 0.529 | CYP3A4-substrate: | 0.914 |
| Clearance (CL): | 5.162 | Half-life (T1/2): | 0.213 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.089 |
| Drug-inuced Liver Injury (DILI): | 0.931 | AMES Toxicity: | 0.033 |
| Rat Oral Acute Toxicity: | 0.996 | Maximum Recommended Daily Dose: | 0.915 |
| Skin Sensitization: | 0.373 | Carcinogencity: | 0.776 |
| Eye Corrosion: | 0.047 | Eye Irritation: | 0.066 |
| Respiratory Toxicity: | 0.947 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002133 | ![]() |
0.644 | D0WY9N | ![]() |
0.259 | ||
| ENC003500 | ![]() |
0.627 | D08NQZ | ![]() |
0.231 | ||
| ENC003887 | ![]() |
0.585 | D0R6RC | ![]() |
0.228 | ||
| ENC003762 | ![]() |
0.569 | D0J2NK | ![]() |
0.228 | ||
| ENC003579 | ![]() |
0.536 | D02GAC | ![]() |
0.227 | ||
| ENC003886 | ![]() |
0.523 | D04VEJ | ![]() |
0.218 | ||
| ENC004085 | ![]() |
0.500 | D05AFR | ![]() |
0.212 | ||
| ENC003250 | ![]() |
0.444 | D0S0LZ | ![]() |
0.207 | ||
| ENC004472 | ![]() |
0.430 | D0G4OD | ![]() |
0.203 | ||
| ENC005987 | ![]() |
0.419 | D08LTU | ![]() |
0.203 | ||