|
Name |
(4S,4aR,5aS,9bS)-2,9-bis[(2E,4E)-hexa-2,4-dienoyl]-4,4a,6,8-tetrahydroxy-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3-one
|
| Molecular Formula | C28H32O8 | |
| IUPAC Name* |
(4S,4aR,5aS,9Z,9bS)-2-[(2E,4E)-hexa-2,4-dienoyl]-4,4a,8-trihydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione
|
|
| SMILES |
C/C=C/C=C/C(=O)C1=C[C@]2(C3/C(=C(\C=C\C=C\C)/O)/C(=C(C(=O)[C@]3(O[C@]2([C@@](C1=O)(C)O)O)C)C)O)C
|
|
| InChI |
InChI=1S/C28H32O8/c1-7-9-11-13-18(29)17-15-25(4)22-20(19(30)14-12-10-8-2)21(31)16(3)23(32)26(22,5)36-28(25,35)27(6,34)24(17)33/h7-15,22,30-31,34-35H,1-6H3/b9-7+,10-8+,13-11+,14-12+,20-19+/t22?,25-,26-,27-,28+/m0/s1
|
|
| InChIKey |
NCHYGSCJZYVXGX-CDPVNDDBSA-N
|
|
| Synonyms |
bisvertinolone; (4S,4aR,5aS,9bS)-2,9-bis[(2E,4E)-hexa-2,4-dienoyl]-4,4a,6,8-tetrahydroxy-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3-one
|
|
| CAS | NA | |
| PubChem CID | 134816576 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 496.5 | ALogp: | 2.9 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 141.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 36 | QED Weighted: | 0.192 |
| Caco-2 Permeability: | -4.916 | MDCK Permeability: | 0.00001640 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.026 |
| Human Intestinal Absorption (HIA): | 0.084 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.004 |
| Blood-Brain-Barrier Penetration (BBB): | 0.898 | Plasma Protein Binding (PPB): | 87.95% |
| Volume Distribution (VD): | 2.121 | Fu: | 6.81% |
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.914 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.791 |
| CYP2C9-inhibitor: | 0.045 | CYP2C9-substrate: | 0.013 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.048 |
| CYP3A4-inhibitor: | 0.723 | CYP3A4-substrate: | 0.923 |
| Clearance (CL): | 3.651 | Half-life (T1/2): | 0.178 |
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.337 |
| Drug-inuced Liver Injury (DILI): | 0.838 | AMES Toxicity: | 0.411 |
| Rat Oral Acute Toxicity: | 0.744 | Maximum Recommended Daily Dose: | 0.962 |
| Skin Sensitization: | 0.93 | Carcinogencity: | 0.874 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.96 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002144 | ![]() |
0.627 | D05QDC | ![]() |
0.214 | ||
| ENC003887 | ![]() |
0.608 | D0FG6M | ![]() |
0.208 | ||
| ENC003250 | ![]() |
0.532 | D0E9KA | ![]() |
0.204 | ||
| ENC003886 | ![]() |
0.531 | D00DKK | ![]() |
0.203 | ||
| ENC004472 | ![]() |
0.516 | D0G3PI | ![]() |
0.203 | ||
| ENC005987 | ![]() |
0.504 | D02DGU | ![]() |
0.203 | ||
| ENC003709 | ![]() |
0.500 | D08NQZ | ![]() |
0.201 | ||
| ENC003128 | ![]() |
0.484 | D0R6RC | ![]() |
0.199 | ||
| ENC003579 | ![]() |
0.439 | D0J2NK | ![]() |
0.199 | ||
| ENC003762 | ![]() |
0.425 | D0WY9N | ![]() |
0.196 | ||