|
Name |
Demethyltrichodimerol
|
| Molecular Formula | C27H30O8 | |
| IUPAC Name* |
(1S,3R,4R,6Z,8S,10R,11R,13Z)-3,10-dihydroxy-6,13-bis[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-1,4,8-trimethyl-2,9-dioxapentacyclo[8.4.0.03,8.04,14.07,11]tetradecane-5,12-dione
|
|
| SMILES |
C/C=C/C=C/C(=C/1\C2[C@@H]3C(=O)/C(=C(/C=C/C=C/C)\O)/C4[C@](C1=O)([C@@]5([C@]2(O[C@]3([C@]4(O5)C)O)C)O)C)/O
|
|
| InChI |
InChI=1S/C27H30O8/c1-6-8-10-12-14(28)16-18-19-20(30)17(15(29)13-11-9-7-2)21-23(3,22(16)31)27(33)24(18,4)34-26(19,32)25(21,5)35-27/h6-13,18-19,21,28-29,32-33H,1-5H3/b8-6+,9-7+,12-10+,13-11+,16-14-,17-15+/t18?,19-,21?,23-,24+,25+,26-,27-/m1/s1
|
|
| InChIKey |
ULPDBVGKXVRYQX-NJLDYWKQSA-N
|
|
| Synonyms |
Demethyltrichodimerol
|
|
| CAS | NA | |
| PubChem CID | 139586846 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 482.5 | ALogp: | 2.1 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 134.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 35 | QED Weighted: | 0.271 |
| Caco-2 Permeability: | -5.176 | MDCK Permeability: | 0.00002470 |
| Pgp-inhibitor: | 0.992 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.077 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.025 |
| Blood-Brain-Barrier Penetration (BBB): | 0.754 | Plasma Protein Binding (PPB): | 75.19% |
| Volume Distribution (VD): | 2.176 | Fu: | 12.00% |
| CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.835 |
| CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.797 |
| CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.007 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.087 |
| CYP3A4-inhibitor: | 0.159 | CYP3A4-substrate: | 0.92 |
| Clearance (CL): | 7.965 | Half-life (T1/2): | 0.074 |
| hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.159 |
| Drug-inuced Liver Injury (DILI): | 0.861 | AMES Toxicity: | 0.096 |
| Rat Oral Acute Toxicity: | 0.944 | Maximum Recommended Daily Dose: | 0.958 |
| Skin Sensitization: | 0.794 | Carcinogencity: | 0.899 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.018 |
| Respiratory Toxicity: | 0.969 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004472 | ![]() |
0.727 | D0FG6M | ![]() |
0.225 | ||
| ENC005987 | ![]() |
0.712 | D0KR9U | ![]() |
0.186 | ||
| ENC003762 | ![]() |
0.532 | D0G3PI | ![]() |
0.186 | ||
| ENC003128 | ![]() |
0.524 | D00DKK | ![]() |
0.186 | ||
| ENC003500 | ![]() |
0.500 | D02DGU | ![]() |
0.186 | ||
| ENC003887 | ![]() |
0.500 | D0H2MO | ![]() |
0.181 | ||
| ENC003250 | ![]() |
0.477 | D0E9KA | ![]() |
0.181 | ||
| ENC003886 | ![]() |
0.434 | D0J2NK | ![]() |
0.176 | ||
| ENC002144 | ![]() |
0.415 | D0G6AB | ![]() |
0.173 | ||
| ENC003579 | ![]() |
0.390 | D0MY8N | ![]() |
0.172 | ||