|
Name |
(1S,3R,4R,8S,10R,11R)-13-[(E)-hex-4-enoyl]-3,10,12-trihydroxy-6-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-1,4,8,11-tetramethyl-2,9-dioxapentacyclo[8.4.0.03,8.04,14.07,11]tetradec-12-en-5-one
|
| Molecular Formula | C28H34O8 | |
| IUPAC Name* |
(1S,3R,4R,8S,10R,11R)-13-[(E)-hex-4-enoyl]-3,10,12-trihydroxy-6-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-1,4,8,11-tetramethyl-2,9-dioxapentacyclo[8.4.0.03,8.04,14.07,11]tetradec-12-en-5-one
|
|
| SMILES |
C/C=C/CCC(=O)C1=C([C@]2(C3C(=C(/C=C/C=C/C)O)C(=O)[C@]4(C1[C@]5([C@@]2(O[C@@]3([C@@]4(O5)O)C)O)C)C)C)O
|
|
| InChI |
InChI=1S/C28H34O8/c1-7-9-11-13-15(29)17-19-23(3)22(32)18(16(30)14-12-10-8-2)20-24(4,21(17)31)28(34)25(19,5)35-27(23,33)26(20,6)36-28/h7-11,13,19-20,29,32-34H,12,14H2,1-6H3/b9-7+,10-8+,13-11+,17-15?/t19?,20?,23-,24-,25+,26+,27-,28-/m1/s1
|
|
| InChIKey |
VXNANBMCYPZBSM-VPIXFZJBSA-N
|
|
| Synonyms |
dihydrotrichodimerol
|
|
| CAS | NA | |
| PubChem CID | 139587822 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 498.6 | ALogp: | 2.3 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 134.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 36 | QED Weighted: | 0.185 |
| Caco-2 Permeability: | -5.442 | MDCK Permeability: | 0.00001660 |
| Pgp-inhibitor: | 0.282 | Pgp-substrate: | 0.296 |
| Human Intestinal Absorption (HIA): | 0.164 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.029 |
| Blood-Brain-Barrier Penetration (BBB): | 0.938 | Plasma Protein Binding (PPB): | 87.70% |
| Volume Distribution (VD): | 1.174 | Fu: | 9.42% |
| CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.937 |
| CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.794 |
| CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.005 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.058 |
| CYP3A4-inhibitor: | 0.72 | CYP3A4-substrate: | 0.932 |
| Clearance (CL): | 7.752 | Half-life (T1/2): | 0.049 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.153 |
| Drug-inuced Liver Injury (DILI): | 0.786 | AMES Toxicity: | 0.179 |
| Rat Oral Acute Toxicity: | 0.966 | Maximum Recommended Daily Dose: | 0.927 |
| Skin Sensitization: | 0.538 | Carcinogencity: | 0.976 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.018 |
| Respiratory Toxicity: | 0.975 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004472 | ![]() |
0.670 | D0H2MO | ![]() |
0.217 | ||
| ENC002144 | ![]() |
0.569 | D0E9KA | ![]() |
0.195 | ||
| ENC003709 | ![]() |
0.532 | D0WY9N | ![]() |
0.187 | ||
| ENC005987 | ![]() |
0.500 | D03ZFG | ![]() |
0.186 | ||
| ENC003187 | ![]() |
0.488 | D0FG6M | ![]() |
0.184 | ||
| ENC003579 | ![]() |
0.469 | D02DGU | ![]() |
0.183 | ||
| ENC005695 | ![]() |
0.457 | D0G3PI | ![]() |
0.183 | ||
| ENC004085 | ![]() |
0.447 | D00DKK | ![]() |
0.183 | ||
| ENC002133 | ![]() |
0.440 | D02QJH | ![]() |
0.182 | ||
| ENC003500 | ![]() |
0.425 | D03ZZK | ![]() |
0.180 | ||