![]() |
Name |
Saturnispol A
|
Molecular Formula | C28H34O10 | |
IUPAC Name* |
(4S,4aR,5aS,9aR,9bR)-2,9-bis[(2E,4E)-1,6-dihydroxyhexa-2,4-dienylidene]-4,4a,8-trihydroxy-4,5a,7,9b-tetramethyl-3,9a-dihydrodibenzofuran-1,6-dione
|
|
SMILES |
CC1=C(C(=C(/C=C/C=C/CO)O)[C@@H]2[C@@]3(C(=O)C(=C(/C=C/C=C/CO)O)C[C@]([C@@]3(O[C@@]2(C1=O)C)O)(C)O)C)O
|
|
InChI |
InChI=1S/C28H34O10/c1-16-21(33)20(19(32)12-8-6-10-14-30)22-26(3)24(35)17(18(31)11-7-5-9-13-29)15-25(2,36)28(26,37)38-27(22,4)23(16)34/h5-12,22,29-33,36-37H,13-15H2,1-4H3/b9-5+,10-6+,11-7+,12-8+,18-17?,20-19?/t22-,25+,26-,27+,28+/m1/s1
|
|
InChIKey |
IPWFJFQVSWIPLL-KNNDUHNWSA-N
|
|
Synonyms |
Saturnispol A
|
|
CAS | NA | |
PubChem CID | 139590666 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 530.6 | ALogp: | 0.6 |
HBD: | 7 | HBA: | 10 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 185.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 38 | QED Weighted: | 0.153 |
Caco-2 Permeability: | -5.448 | MDCK Permeability: | 0.00001720 |
Pgp-inhibitor: | 0.095 | Pgp-substrate: | 0.97 |
Human Intestinal Absorption (HIA): | 0.06 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.955 | Plasma Protein Binding (PPB): | 61.83% |
Volume Distribution (VD): | 0.583 | Fu: | 29.10% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.897 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.203 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.017 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.035 |
CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.732 |
Clearance (CL): | 2.483 | Half-life (T1/2): | 0.19 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.056 |
Drug-inuced Liver Injury (DILI): | 0.218 | AMES Toxicity: | 0.75 |
Rat Oral Acute Toxicity: | 0.058 | Maximum Recommended Daily Dose: | 0.884 |
Skin Sensitization: | 0.937 | Carcinogencity: | 0.558 |
Eye Corrosion: | 0.028 | Eye Irritation: | 0.054 |
Respiratory Toxicity: | 0.98 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003887 | ![]() |
0.877 | D0FG6M | ![]() |
0.208 | ||
ENC003500 | ![]() |
0.531 | D02GAC | ![]() |
0.199 | ||
ENC002144 | ![]() |
0.523 | D0S7WX | ![]() |
0.197 | ||
ENC005987 | ![]() |
0.492 | D04VEJ | ![]() |
0.187 | ||
ENC004472 | ![]() |
0.438 | D08NQZ | ![]() |
0.186 | ||
ENC003709 | ![]() |
0.434 | D0G3PI | ![]() |
0.185 | ||
ENC003250 | ![]() |
0.380 | D02DGU | ![]() |
0.185 | ||
ENC003762 | ![]() |
0.368 | D00DKK | ![]() |
0.185 | ||
ENC003579 | ![]() |
0.352 | D0J2NK | ![]() |
0.184 | ||
ENC003128 | ![]() |
0.342 | D0R6RC | ![]() |
0.184 |