|
Name |
Tetrahydrobisvertinolone
|
| Molecular Formula | C28H36O9 | |
| IUPAC Name* |
(4S,4aR,5aS,9aR,9bR)-2,9-bis[(E)-hex-4-enoyl]-1,4,4a,6,8-pentahydroxy-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3-one
|
|
| SMILES |
C/C=C/CCC(=O)C1=C(C(=C([C@@]2([C@H]1[C@@]3(C(=C(C(=O)[C@]([C@@]3(O2)O)(C)O)C(=O)CC/C=C/C)O)C)C)O)C)O
|
|
| InChI |
InChI=1S/C28H36O9/c1-7-9-11-13-16(29)18-20(31)15(3)22(32)26(5)21(18)25(4)23(33)19(17(30)14-12-10-8-2)24(34)27(6,35)28(25,36)37-26/h7-10,21,31-33,35-36H,11-14H2,1-6H3/b9-7+,10-8+/t21-,25-,26+,27+,28-/m1/s1
|
|
| InChIKey |
FEQQKMZNFKCWST-QCNVSJCTSA-N
|
|
| Synonyms |
Tetrahydrobisvertinolone
|
|
| CAS | NA | |
| PubChem CID | 11272310 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 516.6 | ALogp: | 1.9 |
| HBD: | 5 | HBA: | 9 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 162.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 37 | QED Weighted: | 0.232 |
| Caco-2 Permeability: | -5.403 | MDCK Permeability: | 0.00005610 |
| Pgp-inhibitor: | 0.457 | Pgp-substrate: | 0.957 |
| Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.592 |
| 30% Bioavailability (F30%): | 0.006 |
| Blood-Brain-Barrier Penetration (BBB): | 0.028 | Plasma Protein Binding (PPB): | 76.87% |
| Volume Distribution (VD): | 0.749 | Fu: | 9.79% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.678 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.729 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.017 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.03 |
| CYP3A4-inhibitor: | 0.708 | CYP3A4-substrate: | 0.812 |
| Clearance (CL): | 5.851 | Half-life (T1/2): | 0.225 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.127 |
| Drug-inuced Liver Injury (DILI): | 0.932 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 1 | Maximum Recommended Daily Dose: | 0.09 |
| Skin Sensitization: | 0.069 | Carcinogencity: | 0.464 |
| Eye Corrosion: | 0.647 | Eye Irritation: | 0.09 |
| Respiratory Toxicity: | 0.954 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002144 | ![]() |
0.644 | D0WY9N | ![]() |
0.303 | ||
| ENC004086 | ![]() |
0.548 | D04VEJ | ![]() |
0.233 | ||
| ENC004085 | ![]() |
0.455 | D08NQZ | ![]() |
0.231 | ||
| ENC003762 | ![]() |
0.440 | D0R6RC | ![]() |
0.228 | ||
| ENC003187 | ![]() |
0.399 | D0J2NK | ![]() |
0.228 | ||
| ENC003500 | ![]() |
0.391 | D02GAC | ![]() |
0.227 | ||
| ENC003579 | ![]() |
0.391 | D05AFR | ![]() |
0.212 | ||
| ENC005695 | ![]() |
0.364 | D0G4OD | ![]() |
0.211 | ||
| ENC003887 | ![]() |
0.354 | D0S0LZ | ![]() |
0.207 | ||
| ENC003886 | ![]() |
0.338 | D03ZFG | ![]() |
0.205 | ||