|
Name |
10,11,16,17-Tetrahydrobislongiquinolide
|
| Molecular Formula | C28H36O8 | |
| IUPAC Name* |
(5S)-5-[(2S,4R,7S)-3,6-di(hex-4-enoyl)-5,7-dihydroxy-4,7-dimethyl-8-oxo-2-bicyclo[2.2.2]oct-5-enyl]-4-hydroxy-3,5-dimethylfuran-2-one
|
|
| SMILES |
CC=CCCC(=O)C1[C@H](C2C(=C([C@@]1(C(=O)[C@@]2(C)O)C)O)C(=O)CCC=CC)[C@]3(C(=C(C(=O)O3)C)O)C
|
|
| InChI |
InChI=1S/C28H36O8/c1-7-9-11-13-16(29)18-20-21(28(6)22(31)15(3)24(33)36-28)19(17(30)14-12-10-8-2)26(4,23(18)32)25(34)27(20,5)35/h7-10,19-21,31-32,35H,11-14H2,1-6H3/t19?,20?,21-,26-,27+,28+/m1/s1
|
|
| InChIKey |
YPFBPKRPSSNAII-JMQZAYEBSA-N
|
|
| Synonyms |
10,11,16,17-tetrahydrobislongiquinolide
|
|
| CAS | NA | |
| PubChem CID | 146683017 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 500.6 | ALogp: | 2.1 |
| HBD: | 3 | HBA: | 8 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 138.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.308 |
| Caco-2 Permeability: | -4.963 | MDCK Permeability: | 0.00005870 |
| Pgp-inhibitor: | 0.971 | Pgp-substrate: | 0.477 |
| Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.005 |
| Blood-Brain-Barrier Penetration (BBB): | 0.539 | Plasma Protein Binding (PPB): | 62.94% |
| Volume Distribution (VD): | 0.498 | Fu: | 38.00% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.589 |
| CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.675 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.058 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.021 |
| CYP3A4-inhibitor: | 0.924 | CYP3A4-substrate: | 0.705 |
| Clearance (CL): | 10.461 | Half-life (T1/2): | 0.432 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.078 |
| Drug-inuced Liver Injury (DILI): | 0.619 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.974 | Maximum Recommended Daily Dose: | 0.042 |
| Skin Sensitization: | 0.021 | Carcinogencity: | 0.642 |
| Eye Corrosion: | 0.974 | Eye Irritation: | 0.237 |
| Respiratory Toxicity: | 0.458 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004085 | ![]() |
0.776 | D0WY9N | ![]() |
0.245 | ||
| ENC003579 | ![]() |
0.667 | D03ZFG | ![]() |
0.241 | ||
| ENC002133 | ![]() |
0.548 | D0E9KA | ![]() |
0.221 | ||
| ENC003250 | ![]() |
0.508 | D0J2NK | ![]() |
0.215 | ||
| ENC005696 | ![]() |
0.447 | D04VEJ | ![]() |
0.214 | ||
| ENC002144 | ![]() |
0.412 | D0H2MO | ![]() |
0.203 | ||
| ENC003762 | ![]() |
0.364 | D08NQZ | ![]() |
0.201 | ||
| ENC005202 | ![]() |
0.343 | D0G4OD | ![]() |
0.199 | ||
| ENC005695 | ![]() |
0.337 | D02GAC | ![]() |
0.199 | ||
| ENC003187 | ![]() |
0.326 | D0R6RC | ![]() |
0.199 | ||