![]() |
Name |
9-Methylene-9H-fluorene
|
Molecular Formula | C14H10 | |
IUPAC Name* |
9-methylidenefluorene
|
|
SMILES |
C=C1C2=CC=CC=C2C3=CC=CC=C13
|
|
InChI |
InChI=1S/C14H10/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-9H,1H2
|
|
InChIKey |
ZYASLTYCYTYKFC-UHFFFAOYSA-N
|
|
Synonyms |
9-methylidenefluorene; 4425-82-5; 9-Methylene-9H-fluorene; 9H-Fluorene, 9-methylene-; dibenzofulvene; 9-Methylene-fluorene; fluorenylidenemethane; 9-METHYLIDENE-9H-FLUORENE; 9299E1P3CC; UNII-9299E1P3CC; 9-methylenefluorene; 9-Methylene-9H-fluorene #; DTXSID90196082; BCP31131; MFCD11850122; ZINC67738097; AKOS025296161; BS-16818; HY-100066; CS-0018044; EN300-223143; Q27271491; 9H-Fluorene, 9-methylene-;9-Methylene-9H-fluorene;9-Methylene-fluorene
|
|
CAS | 4425-82-5 | |
PubChem CID | 78147 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 178.23 | ALogp: | 3.7 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 14 | QED Weighted: | 0.478 |
Caco-2 Permeability: | -4.566 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.023 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.617 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.526 | Plasma Protein Binding (PPB): | 95.88% |
Volume Distribution (VD): | 0.957 | Fu: | 2.68% |
CYP1A2-inhibitor: | 0.892 | CYP1A2-substrate: | 0.733 |
CYP2C19-inhibitor: | 0.666 | CYP2C19-substrate: | 0.156 |
CYP2C9-inhibitor: | 0.353 | CYP2C9-substrate: | 0.794 |
CYP2D6-inhibitor: | 0.09 | CYP2D6-substrate: | 0.854 |
CYP3A4-inhibitor: | 0.221 | CYP3A4-substrate: | 0.271 |
Clearance (CL): | 6.737 | Half-life (T1/2): | 0.05 |
hERG Blockers: | 0.338 | Human Hepatotoxicity (H-HT): | 0.121 |
Drug-inuced Liver Injury (DILI): | 0.876 | AMES Toxicity: | 0.745 |
Rat Oral Acute Toxicity: | 0.877 | Maximum Recommended Daily Dose: | 0.877 |
Skin Sensitization: | 0.111 | Carcinogencity: | 0.757 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.185 |
Respiratory Toxicity: | 0.031 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000159 | ![]() |
0.538 | D08FTG | ![]() |
0.475 | ||
ENC000047 | ![]() |
0.449 | D04WFD | ![]() |
0.408 | ||
ENC000036 | ![]() |
0.429 | D01KHH | ![]() |
0.397 | ||
ENC001371 | ![]() |
0.412 | D0Y5UG | ![]() |
0.397 | ||
ENC000171 | ![]() |
0.407 | D06FES | ![]() |
0.397 | ||
ENC001388 | ![]() |
0.397 | D0Q2MN | ![]() |
0.397 | ||
ENC000321 | ![]() |
0.392 | D0QL3P | ![]() |
0.397 | ||
ENC001372 | ![]() |
0.391 | D0E0RY | ![]() |
0.392 | ||
ENC001375 | ![]() |
0.390 | D00TLN | ![]() |
0.377 | ||
ENC004648 | ![]() |
0.375 | D0B1FE | ![]() |
0.375 |