![]() |
Name |
9H-Xanthene
|
Molecular Formula | C13H10O | |
IUPAC Name* |
9H-xanthene
|
|
SMILES |
C1C2=CC=CC=C2OC3=CC=CC=C31
|
|
InChI |
InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2
|
|
InChIKey |
GJCOSYZMQJWQCA-UHFFFAOYSA-N
|
|
Synonyms |
9H-Xanthene; XANTHENE; 92-83-1; 10H-9-Oxaanthracene; Xanthan; Dibenzo[a,e]pyran; NSC 46931; 9-oxa-9,10-dihydroanthracene; CHEBI:10057; NSC-46931; A762Z8101Y; Xanthenes; SMR000857210; EINECS 202-194-4; BRN 0133939; xanthene-; AI3-01544; UNII-A762Z8101Y; Xanthene, 99%; Dibenzopyran, tricyclic; SCHEMBL4267; 5-17-02-00252 (Beilstein Handbook Reference); MLS001333245; MLS001333246; CHEMBL486760; DTXSID1059070; HMS2231P24; HMS3371P15; ZINC967535; NSC46931; MFCD00005055; AKOS016008734; CS-W017106; NCGC00247062-01; AS-56278; 4-(ACETOXYMETHYL)BENZENEBORONICACID; DB-057333; FT-0603304; X0003; C01464; D70448; EN300-7407236; A859966; AE-562/43285774; Q413791; (R)-2-Piperazinecarboxylic acid dihydrochloride, 98%; Z1255415427
|
|
CAS | 92-83-1 | |
PubChem CID | 7107 | |
ChEMBL ID | CHEMBL486760 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 182.22 | ALogp: | 3.5 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 9.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 14 | QED Weighted: | 0.507 |
Caco-2 Permeability: | -4.709 | MDCK Permeability: | 0.00003000 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.034 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.862 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.628 | Plasma Protein Binding (PPB): | 97.59% |
Volume Distribution (VD): | 0.841 | Fu: | 2.83% |
CYP1A2-inhibitor: | 0.955 | CYP1A2-substrate: | 0.597 |
CYP2C19-inhibitor: | 0.943 | CYP2C19-substrate: | 0.2 |
CYP2C9-inhibitor: | 0.582 | CYP2C9-substrate: | 0.864 |
CYP2D6-inhibitor: | 0.106 | CYP2D6-substrate: | 0.75 |
CYP3A4-inhibitor: | 0.11 | CYP3A4-substrate: | 0.566 |
Clearance (CL): | 11.166 | Half-life (T1/2): | 0.565 |
hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.043 |
Drug-inuced Liver Injury (DILI): | 0.727 | AMES Toxicity: | 0.359 |
Rat Oral Acute Toxicity: | 0.032 | Maximum Recommended Daily Dose: | 0.21 |
Skin Sensitization: | 0.713 | Carcinogencity: | 0.628 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.966 |
Respiratory Toxicity: | 0.373 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000159 | ![]() |
0.620 | D0DV3O | ![]() |
0.463 | ||
ENC000681 | ![]() |
0.479 | D0R6RO | ![]() |
0.443 | ||
ENC000036 | ![]() |
0.446 | D0QL3P | ![]() |
0.412 | ||
ENC000047 | ![]() |
0.440 | D06FES | ![]() |
0.411 | ||
ENC000737 | ![]() |
0.407 | D04WFD | ![]() |
0.403 | ||
ENC000038 | ![]() |
0.396 | D01UTL | ![]() |
0.403 | ||
ENC000321 | ![]() |
0.385 | D06ZUK | ![]() |
0.392 | ||
ENC001050 | ![]() |
0.377 | D0Y5UG | ![]() |
0.392 | ||
ENC003440 | ![]() |
0.370 | D04QZD | ![]() |
0.391 | ||
ENC000732 | ![]() |
0.369 | D00HZV | ![]() |
0.382 |