![]() |
Name |
9,9-Diazidofluorene
|
Molecular Formula | C13H8N6 | |
IUPAC Name* |
9,9-diazidofluorene
|
|
SMILES |
C1=CC=C2C(=C1)C3=CC=CC=C3C2(N=[N+]=[N-])N=[N+]=[N-]
|
|
InChI |
InChI=1S/C13H8N6/c14-18-16-13(17-19-15)11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H
|
|
InChIKey |
WZLKWXYQZUCRDK-UHFFFAOYSA-N
|
|
Synonyms |
9,9-Diazidofluorene
|
|
CAS | NA | |
PubChem CID | 601071 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 248.24 | ALogp: | 5.2 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 28.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.406 |
Caco-2 Permeability: | -5.523 | MDCK Permeability: | 0.00012244 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.478 |
Blood-Brain-Barrier Penetration (BBB): | 0.182 | Plasma Protein Binding (PPB): | 95.22% |
Volume Distribution (VD): | 3.617 | Fu: | 10.01% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.098 |
CYP2C19-inhibitor: | 0.088 | CYP2C19-substrate: | 0.991 |
CYP2C9-inhibitor: | 0.409 | CYP2C9-substrate: | 0.953 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.085 |
CYP3A4-inhibitor: | 0.506 | CYP3A4-substrate: | 0.96 |
Clearance (CL): | 1.038 | Half-life (T1/2): | 0.084 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.747 |
Drug-inuced Liver Injury (DILI): | 0.299 | AMES Toxicity: | 1 |
Rat Oral Acute Toxicity: | 0.206 | Maximum Recommended Daily Dose: | 0.874 |
Skin Sensitization: | 0.946 | Carcinogencity: | 0.98 |
Eye Corrosion: | 0.687 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.984 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000159 | ![]() |
0.424 | D0K4CQ | ![]() |
0.412 | ||
ENC000737 | ![]() |
0.412 | D0E0RY | ![]() |
0.393 | ||
ENC000047 | ![]() |
0.349 | D08FTG | ![]() |
0.368 | ||
ENC000036 | ![]() |
0.343 | D03KQF | ![]() |
0.330 | ||
ENC002863 | ![]() |
0.329 | D04WFD | ![]() |
0.326 | ||
ENC000171 | ![]() |
0.329 | D0Y5UG | ![]() |
0.318 | ||
ENC004649 | ![]() |
0.318 | D06FES | ![]() |
0.318 | ||
ENC001375 | ![]() |
0.315 | D01KHH | ![]() |
0.318 | ||
ENC000321 | ![]() |
0.308 | D0Q2MN | ![]() |
0.318 | ||
ENC000732 | ![]() |
0.308 | D0QL3P | ![]() |
0.313 |