![]() |
Name |
1,10b(2H)-Dihydropyrano[3,4,5-jk]fluorene
|
Molecular Formula | C15H12O | |
IUPAC Name* |
3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene
|
|
SMILES |
C1C2C3=CC=CC=C3C4=CC=CC(=C24)CO1
|
|
InChI |
InChI=1S/C15H12O/c1-2-6-12-11(5-1)13-7-3-4-10-8-16-9-14(12)15(10)13/h1-7,14H,8-9H2
|
|
InChIKey |
DZYSMGRTXSUCRH-UHFFFAOYSA-N
|
|
Synonyms |
1,10b(2H)-Dihydropyrano[3,4,5-jk]fluorene; SCHEMBL1099557; 3,10b-Dihydro-1H-indeno[1,2,3-de]isochromene #
|
|
CAS | NA | |
PubChem CID | 601134 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.25 | ALogp: | 2.8 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 9.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 16 | QED Weighted: | 0.633 |
Caco-2 Permeability: | -4.545 | MDCK Permeability: | 0.00003010 |
Pgp-inhibitor: | 0.318 | Pgp-substrate: | 0.027 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.279 |
30% Bioavailability (F30%): | 0.046 |
Blood-Brain-Barrier Penetration (BBB): | 0.95 | Plasma Protein Binding (PPB): | 95.40% |
Volume Distribution (VD): | 1.61 | Fu: | 4.34% |
CYP1A2-inhibitor: | 0.384 | CYP1A2-substrate: | 0.891 |
CYP2C19-inhibitor: | 0.622 | CYP2C19-substrate: | 0.658 |
CYP2C9-inhibitor: | 0.469 | CYP2C9-substrate: | 0.707 |
CYP2D6-inhibitor: | 0.069 | CYP2D6-substrate: | 0.837 |
CYP3A4-inhibitor: | 0.369 | CYP3A4-substrate: | 0.738 |
Clearance (CL): | 3.78 | Half-life (T1/2): | 0.151 |
hERG Blockers: | 0.069 | Human Hepatotoxicity (H-HT): | 0.067 |
Drug-inuced Liver Injury (DILI): | 0.234 | AMES Toxicity: | 0.964 |
Rat Oral Acute Toxicity: | 0.331 | Maximum Recommended Daily Dose: | 0.93 |
Skin Sensitization: | 0.384 | Carcinogencity: | 0.768 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.667 |
Respiratory Toxicity: | 0.402 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000159 | ![]() |
0.450 | D06FES | ![]() |
0.380 | ||
ENC000737 | ![]() |
0.391 | D04WFD | ![]() |
0.372 | ||
ENC000171 | ![]() |
0.364 | D0DV3O | ![]() |
0.368 | ||
ENC000673 | ![]() |
0.345 | D08FTG | ![]() |
0.366 | ||
ENC001388 | ![]() |
0.338 | D0Y5UG | ![]() |
0.363 | ||
ENC000167 | ![]() |
0.333 | D06UDO | ![]() |
0.354 | ||
ENC006142 | ![]() |
0.323 | D05AFX | ![]() |
0.351 | ||
ENC000321 | ![]() |
0.322 | D0Q2MN | ![]() |
0.346 | ||
ENC000036 | ![]() |
0.318 | D0QL3P | ![]() |
0.342 | ||
ENC001031 | ![]() |
0.317 | D04QZD | ![]() |
0.342 |