![]() |
Name |
2-Methyl-7-phenyl-1H-indole
|
Molecular Formula | C15H13N | |
IUPAC Name* |
2-methyl-7-phenyl-1H-indole
|
|
SMILES |
CC1=CC2=C(N1)C(=CC=C2)C3=CC=CC=C3
|
|
InChI |
InChI=1S/C15H13N/c1-11-10-13-8-5-9-14(15(13)16-11)12-6-3-2-4-7-12/h2-10,16H,1H3
|
|
InChIKey |
NZAAIMVQAOYHBU-UHFFFAOYSA-N
|
|
Synonyms |
2-Methyl-7-phenylindole; 2-Methyl-7-phenyl-1H-indole; SCHEMBL11719410; 2-Methyl-7-phenyl-1H-indole #; Q63398204
|
|
CAS | NA | |
PubChem CID | 610181 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 207.27 | ALogp: | 4.1 |
HBD: | 1 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 15.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 16 | QED Weighted: | 0.593 |
Caco-2 Permeability: | -4.785 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.02 | Pgp-substrate: | 0.066 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.97 |
30% Bioavailability (F30%): | 0.699 |
Blood-Brain-Barrier Penetration (BBB): | 0.503 | Plasma Protein Binding (PPB): | 97.50% |
Volume Distribution (VD): | 0.889 | Fu: | 2.04% |
CYP1A2-inhibitor: | 0.99 | CYP1A2-substrate: | 0.83 |
CYP2C19-inhibitor: | 0.815 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.665 | CYP2C9-substrate: | 0.498 |
CYP2D6-inhibitor: | 0.915 | CYP2D6-substrate: | 0.844 |
CYP3A4-inhibitor: | 0.635 | CYP3A4-substrate: | 0.295 |
Clearance (CL): | 6.335 | Half-life (T1/2): | 0.343 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.211 |
Drug-inuced Liver Injury (DILI): | 0.605 | AMES Toxicity: | 0.804 |
Rat Oral Acute Toxicity: | 0.072 | Maximum Recommended Daily Dose: | 0.857 |
Skin Sensitization: | 0.472 | Carcinogencity: | 0.697 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.893 |
Respiratory Toxicity: | 0.925 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000732 | ![]() |
0.492 | D0A1PX | ![]() |
0.426 | ||
ENC000321 | ![]() |
0.481 | D0R2OA | ![]() |
0.408 | ||
ENC000178 | ![]() |
0.462 | D08FTG | ![]() |
0.391 | ||
ENC003390 | ![]() |
0.444 | D07JVL | ![]() |
0.387 | ||
ENC001109 | ![]() |
0.437 | D09LDR | ![]() |
0.387 | ||
ENC000167 | ![]() |
0.436 | D0J6WW | ![]() |
0.377 | ||
ENC000169 | ![]() |
0.411 | D04BNP | ![]() |
0.377 | ||
ENC003482 | ![]() |
0.405 | D0T5WK | ![]() |
0.372 | ||
ENC005445 | ![]() |
0.405 | D0L9GG | ![]() |
0.370 | ||
ENC000047 | ![]() |
0.400 | D0Y7EM | ![]() |
0.368 |