|
Name |
Phonmxanthone A
|
| Molecular Formula | C38H38O16 | |
| IUPAC Name* |
[4-acetyloxy-5-[5-acetyloxy-10a-(acetyloxymethyl)-1,8-dihydroxy-6-methyl-9-oxo-6,7-dihydro-5H-xanthen-4-yl]-1,8-dihydroxy-3-methyl-9-oxo-3,4-dihydro-2H-xanthen-4a-yl]methylacetate
|
|
| SMILES |
CC(=O)OCC12Oc3c(-c4ccc(O)c5c4OC4(COC(C)=O)C(=C(O)CC(C)C4OC(C)=O)C5=O)ccc(O)c3C(=O)C1=C(O)CC(C)C2OC(C)=O
|
|
| InChI |
InChI=1S/C38H38O16/c1-15-11-25(45)29-31(47)27-23(43)9-7-21(33(27)53-37(29,13-49-17(3)39)35(15)51-19(5)41)22-8-10-24(44)28-32(48)30-26(46)12-16(2)36(52-20(6)42)38(30,54-34(22)28)14-50-18(4)40/h7-10,15-16,35-36,43-46H,11-14H2,1-6H3/t15-,16-,35-,36-,37+,38+/m0/s1
|
|
| InChIKey |
OHHXJWHRQGZQJM-CMDKCIDSSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 750.71 | ALogp: | 4.1 |
| HBD: | 4 | HBA: | 16 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 238.7 | Aromatic Rings: | 6 |
| Heavy Atoms: | 54 | QED Weighted: | 0.222 |
| Caco-2 Permeability: | -5.246 | MDCK Permeability: | 0.00004790 |
| Pgp-inhibitor: | 0.961 | Pgp-substrate: | 0.808 |
| Human Intestinal Absorption (HIA): | 0.871 | 20% Bioavailability (F20%): | 0.049 |
| 30% Bioavailability (F30%): | 0.459 |
| Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 80.30% |
| Volume Distribution (VD): | 0.378 | Fu: | 21.71% |
| CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.041 |
| CYP2C19-inhibitor: | 0.045 | CYP2C19-substrate: | 0.06 |
| CYP2C9-inhibitor: | 0.172 | CYP2C9-substrate: | 0.189 |
| CYP2D6-inhibitor: | 0.212 | CYP2D6-substrate: | 0.078 |
| CYP3A4-inhibitor: | 0.634 | CYP3A4-substrate: | 0.274 |
| Clearance (CL): | 1.153 | Half-life (T1/2): | 0.024 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.948 |
| Drug-inuced Liver Injury (DILI): | 0.965 | AMES Toxicity: | 0.029 |
| Rat Oral Acute Toxicity: | 0.998 | Maximum Recommended Daily Dose: | 0.637 |
| Skin Sensitization: | 0.017 | Carcinogencity: | 0.022 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.023 |
| Respiratory Toxicity: | 0.032 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005074 | ![]() |
0.881 | D0Q0PR | ![]() |
0.262 | ||
| ENC001968 | ![]() |
0.825 | D07IPB | ![]() |
0.257 | ||
| ENC004764 | ![]() |
0.802 | D01UBX | ![]() |
0.250 | ||
| ENC001969 | ![]() |
0.749 | D08FPM | ![]() |
0.248 | ||
| ENC002978 | ![]() |
0.721 | D0T5XN | ![]() |
0.247 | ||
| ENC002105 | ![]() |
0.678 | D0FX2Q | ![]() |
0.246 | ||
| ENC005073 | ![]() |
0.661 | D01XWG | ![]() |
0.245 | ||
| ENC002870 | ![]() |
0.651 | D01XDL | ![]() |
0.245 | ||
| ENC001973 | ![]() |
0.587 | D0N1FS | ![]() |
0.244 | ||
| ENC005069 | ![]() |
0.555 | D0OL7F | ![]() |
0.241 | ||