|
Name |
Phomoxanthone A
|
| Molecular Formula | C38H38O16 | |
| IUPAC Name* |
[(3R,4R,4aR)-5-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-4-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate
|
|
| SMILES |
C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O[C@@]2([C@@H]1OC(=O)C)COC(=O)C)C4=C5C(=C(C=C4)O)C(=C6C(=O)C[C@H]([C@H]([C@]6(O5)COC(=O)C)OC(=O)C)C)O)O)O
|
|
| InChI |
InChI=1S/C38H38O16/c1-15-11-25(45)29-31(47)27-23(43)9-7-21(33(27)53-37(29,13-49-17(3)39)35(15)51-19(5)41)22-8-10-24(44)28-32(48)30-26(46)12-16(2)36(52-20(6)42)38(30,54-34(22)28)14-50-18(4)40/h7-10,15-16,35-36,43-44,47-48H,11-14H2,1-6H3/t15-,16-,35-,36-,37+,38+/m1/s1
|
|
| InChIKey |
ZCLZNQUALWMDDN-ACMZUNAXSA-N
|
|
| Synonyms |
Phomoxanthone A; 359844-69-2; CHEBI:66749; [(3R,4R,4aR)-5-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-4-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate; CHEMBL504079; DTXSID401098707; Q27135373; (5R*,5'R*,6R*,6'R*,10aR*,10a'R*)-10a,10a'-bis[(acetyloxy)methyl]-1,1',8,8'-tetrahydroxy-6,6'-dimethyl-9,9'-dioxo-5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-4,4'-bixanthene-5,5'-diyl diacetate; rel-[(5R,5'R,6R,6'R,10aR,10a'R)-5,5'-Diacetoxy-1,1',8,8'-tetrahydroxy-6,6'-dimethyl-9,9'-dioxo-5,5',6,6',7,7',9,9'-octahydro-10aH,10a'H-4,4'-bixanthene-10a,10a'-diyl]bis(methylene) diacetate
|
|
| CAS | 359844-69-2 | |
| PubChem CID | 10033008 | |
| ChEMBL ID | CHEMBL504079 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 750.7 | ALogp: | 2.7 |
| HBD: | 4 | HBA: | 16 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 239.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 54 | QED Weighted: | 0.226 |
| Caco-2 Permeability: | -5.348 | MDCK Permeability: | 0.00003120 |
| Pgp-inhibitor: | 0.921 | Pgp-substrate: | 0.278 |
| Human Intestinal Absorption (HIA): | 0.678 | 20% Bioavailability (F20%): | 0.279 |
| 30% Bioavailability (F30%): | 0.794 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 78.66% |
| Volume Distribution (VD): | 0.418 | Fu: | 19.92% |
| CYP1A2-inhibitor: | 0.047 | CYP1A2-substrate: | 0.041 |
| CYP2C19-inhibitor: | 0.21 | CYP2C19-substrate: | 0.06 |
| CYP2C9-inhibitor: | 0.795 | CYP2C9-substrate: | 0.196 |
| CYP2D6-inhibitor: | 0.607 | CYP2D6-substrate: | 0.064 |
| CYP3A4-inhibitor: | 0.696 | CYP3A4-substrate: | 0.351 |
| Clearance (CL): | 1.746 | Half-life (T1/2): | 0.154 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.99 |
| Drug-inuced Liver Injury (DILI): | 0.975 | AMES Toxicity: | 0.037 |
| Rat Oral Acute Toxicity: | 0.974 | Maximum Recommended Daily Dose: | 0.623 |
| Skin Sensitization: | 0.02 | Carcinogencity: | 0.016 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
| Respiratory Toxicity: | 0.023 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001969 | ![]() |
0.896 | D0Q0PR | ![]() |
0.262 | ||
| ENC002978 | ![]() |
0.881 | D07IPB | ![]() |
0.246 | ||
| ENC005075 | ![]() |
0.825 | D0FX2Q | ![]() |
0.246 | ||
| ENC002105 | ![]() |
0.802 | D0OL7F | ![]() |
0.241 | ||
| ENC002870 | ![]() |
0.786 | D01UBX | ![]() |
0.240 | ||
| ENC005074 | ![]() |
0.721 | D0T5XN | ![]() |
0.235 | ||
| ENC001973 | ![]() |
0.701 | D08FPM | ![]() |
0.235 | ||
| ENC004764 | ![]() |
0.678 | D08LTU | ![]() |
0.233 | ||
| ENC001991 | ![]() |
0.605 | D01XWG | ![]() |
0.233 | ||
| ENC003646 | ![]() |
0.565 | D0L2UN | ![]() |
0.232 | ||