|
Name |
Phomoxanthone B
|
| Molecular Formula | C38H38O16 | |
| IUPAC Name* |
[(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-4-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate
|
|
| SMILES |
C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)C[C@H]([C@H]([C@]6(O5)COC(=O)C)OC(=O)C)C)O)O[C@@]2([C@@H]1OC(=O)C)COC(=O)C)O
|
|
| InChI |
InChI=1S/C38H38O16/c1-15-11-25(45)30-33(48)28-26(53-37(30,13-49-17(3)39)35(15)51-19(5)41)10-8-21(31(28)46)22-7-9-23(43)27-32(47)29-24(44)12-16(2)36(52-20(6)42)38(29,54-34(22)27)14-50-18(4)40/h7-10,15-16,35-36,43,46-48H,11-14H2,1-6H3/t15-,16-,35-,36-,37+,38+/m1/s1
|
|
| InChIKey |
RWPGIQJRECCQEK-ACMZUNAXSA-N
|
|
| Synonyms |
Phomoxanthone B; CHEBI:66750; CHEMBL511092; DTXSID101336289; Q27135374; (5R*,5'R*,6R*,6'R*,10aR*,10a'R*)-10a,10a'-bis[(acetyloxy)methyl]-1,1',8,8'-tetrahydroxy-6,6'-dimethyl-9,9'-dioxo-5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,4'-bixanthene-5,5'-diyl diacetate; [(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-10a-(acetyloxymethyl)-1,9-dihydroxy-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-4-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate; 359844-70-5; rel-[(5R,5'R,6R,6'R,10aR,10a'R)-5,5'-Diacetoxy-1,1',8,8'-tetrahydroxy-6,6'-dimethyl-9,9'-dioxo-5,5',6,6',7,7',9,9'-octahydro-10aH,10a'H-2,4'-bixanthene-10a,10a'-diyl]bis(methylene) diacetate
|
|
| CAS | 359844-70-5 | |
| PubChem CID | 10033009 | |
| ChEMBL ID | CHEMBL511092 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 750.7 | ALogp: | 2.7 |
| HBD: | 4 | HBA: | 16 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 239.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 54 | QED Weighted: | 0.226 |
| Caco-2 Permeability: | -5.371 | MDCK Permeability: | 0.00003300 |
| Pgp-inhibitor: | 0.936 | Pgp-substrate: | 0.308 |
| Human Intestinal Absorption (HIA): | 0.692 | 20% Bioavailability (F20%): | 0.343 |
| 30% Bioavailability (F30%): | 0.838 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 79.83% |
| Volume Distribution (VD): | 0.446 | Fu: | 18.35% |
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.039 |
| CYP2C19-inhibitor: | 0.169 | CYP2C19-substrate: | 0.061 |
| CYP2C9-inhibitor: | 0.755 | CYP2C9-substrate: | 0.232 |
| CYP2D6-inhibitor: | 0.456 | CYP2D6-substrate: | 0.074 |
| CYP3A4-inhibitor: | 0.675 | CYP3A4-substrate: | 0.363 |
| Clearance (CL): | 1.79 | Half-life (T1/2): | 0.145 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.992 |
| Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.032 |
| Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.409 |
| Skin Sensitization: | 0.023 | Carcinogencity: | 0.017 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
| Respiratory Toxicity: | 0.026 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001968 | ![]() |
0.896 | D0Q0PR | ![]() |
0.268 | ||
| ENC002105 | ![]() |
0.896 | D0FX2Q | ![]() |
0.251 | ||
| ENC002870 | ![]() |
0.881 | D07IPB | ![]() |
0.251 | ||
| ENC002978 | ![]() |
0.786 | D01UBX | ![]() |
0.245 | ||
| ENC001973 | ![]() |
0.786 | D0OL7F | ![]() |
0.241 | ||
| ENC004764 | ![]() |
0.749 | D0T5XN | ![]() |
0.241 | ||
| ENC005075 | ![]() |
0.749 | D01XWG | ![]() |
0.239 | ||
| ENC001991 | ![]() |
0.683 | D01XDL | ![]() |
0.239 | ||
| ENC005074 | ![]() |
0.651 | D0G3DL | ![]() |
0.235 | ||
| ENC003646 | ![]() |
0.639 | D04ITO | ![]() |
0.235 | ||