|
Name |
Deacetylphomoxanthone C
|
| Molecular Formula | C33H32O14 | |
| IUPAC Name* |
[5-[5-acetyloxy-1,8-dihydroxy-10a-(hydroxymethyl)-6-methyl-9-oxo-6,7-dihydro-5H-xanthen-4-yl]-1,8-dihydroxy-4a-(hydroxymethyl)-9-oxo-3,4-dihydro-2H-xanthen-4-yl]acetate
|
|
| SMILES |
CC(=O)OC1CCC(O)=C2C(=O)c3c(O)ccc(-c4ccc(O)c5c4OC4(CO)C(=C(O)CC(C)C4OC(C)=O)C5=O)c3OC21CO
|
|
| InChI |
InChI=1S/C33H32O14/c1-13-10-21(41)26-28(43)24-19(39)7-5-17(30(24)47-33(26,12-35)31(13)45-15(3)37)16-4-6-18(38)23-27(42)25-20(40)8-9-22(44-14(2)36)32(25,11-34)46-29(16)23/h4-7,13,22,31,34-35,38-41H,8-12H2,1-3H3/t13-,22-,31-,32-,33+/m0/s1
|
|
| InChIKey |
NLONWCGHYPTYCI-XCIIIWGRSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 652.61 | ALogp: | 2.7 |
| HBD: | 6 | HBA: | 14 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 226.6 | Aromatic Rings: | 6 |
| Heavy Atoms: | 47 | QED Weighted: | 0.254 |
| Caco-2 Permeability: | -5.427 | MDCK Permeability: | 0.00000822 |
| Pgp-inhibitor: | 0.597 | Pgp-substrate: | 0.987 |
| Human Intestinal Absorption (HIA): | 0.697 | 20% Bioavailability (F20%): | 0.315 |
| 30% Bioavailability (F30%): | 0.143 |
| Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 86.12% |
| Volume Distribution (VD): | 0.467 | Fu: | 11.72% |
| CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.058 |
| CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.058 |
| CYP2C9-inhibitor: | 0.039 | CYP2C9-substrate: | 0.232 |
| CYP2D6-inhibitor: | 0.048 | CYP2D6-substrate: | 0.115 |
| CYP3A4-inhibitor: | 0.598 | CYP3A4-substrate: | 0.243 |
| Clearance (CL): | 1.17 | Half-life (T1/2): | 0.064 |
| hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.913 |
| Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.996 | Maximum Recommended Daily Dose: | 0.707 |
| Skin Sensitization: | 0.039 | Carcinogencity: | 0.023 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.054 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005074 | ![]() |
0.750 | D08FPM | ![]() |
0.286 | ||
| ENC005069 | ![]() |
0.662 | D0T5XN | ![]() |
0.275 | ||
| ENC005075 | ![]() |
0.661 | D0C9XJ | ![]() |
0.272 | ||
| ENC002978 | ![]() |
0.622 | D07VLY | ![]() |
0.272 | ||
| ENC005070 | ![]() |
0.603 | D01XDL | ![]() |
0.270 | ||
| ENC002870 | ![]() |
0.556 | D01XWG | ![]() |
0.269 | ||
| ENC001991 | ![]() |
0.554 | D02GAC | ![]() |
0.257 | ||
| ENC001968 | ![]() |
0.548 | D0T8EH | ![]() |
0.252 | ||
| ENC006117 | ![]() |
0.538 | D07IPB | ![]() |
0.249 | ||
| ENC006116 | ![]() |
0.520 | D0N1FS | ![]() |
0.248 | ||