|
Name |
Dicerandrol B
|
| Molecular Formula | C36H36O15 | |
| IUPAC Name* |
[(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-1,9-dihydroxy-10a-(hydroxymethyl)-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate
|
|
| SMILES |
C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)O[C@@]6([C@@H]([C@@H](CC(=O)C6=C5O)C)OC(=O)C)COC(=O)C)O)O[C@@]2([C@@H]1OC(=O)C)CO)O
|
|
| InChI |
InChI=1S/C36H36O15/c1-14-10-21(41)27-31(45)25-23(50-35(27,12-37)33(14)48-17(4)39)8-6-19(29(25)43)20-7-9-24-26(30(20)44)32(46)28-22(42)11-15(2)34(49-18(5)40)36(28,51-24)13-47-16(3)38/h6-9,14-15,33-34,37,43-46H,10-13H2,1-5H3/t14-,15-,33-,34-,35+,36+/m1/s1
|
|
| InChIKey |
ZPEWXLLVRGMQRM-NKSNWBLISA-N
|
|
| Synonyms |
Dicerandrol B; CHEBI:65765; (5R,5'R,6R,6'R,10aR,10a'R)-10a-[(acetyloxy)methyl]-1,1',8,8'-tetrahydroxy-10a'-(hydroxymethyl)-6,6'-dimethyl-9,9'-dioxo-5,5',7,7',9,9',10a,10a'-octahydro-6H,6'H-2,2'-bixanthene-5,5'-diyl diacetate; CHEMBL498888; Q27134252; [(3R,4R,4aR)-7-[(5R,6R,10aR)-5-acetyloxy-1,9-dihydroxy-10a-(hydroxymethyl)-6-methyl-8-oxo-6,7-dihydro-5H-xanthen-2-yl]-4-acetyloxy-8,9-dihydroxy-3-methyl-1-oxo-3,4-dihydro-2H-xanthen-4a-yl]methyl acetate
|
|
| CAS | NA | |
| PubChem CID | 10055578 | |
| ChEMBL ID | CHEMBL498888 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 708.7 | ALogp: | 2.2 |
| HBD: | 5 | HBA: | 15 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 233.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 51 | QED Weighted: | 0.211 |
| Caco-2 Permeability: | -5.592 | MDCK Permeability: | 0.00001860 |
| Pgp-inhibitor: | 0.828 | Pgp-substrate: | 0.764 |
| Human Intestinal Absorption (HIA): | 0.737 | 20% Bioavailability (F20%): | 0.609 |
| 30% Bioavailability (F30%): | 0.868 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 82.87% |
| Volume Distribution (VD): | 0.534 | Fu: | 14.11% |
| CYP1A2-inhibitor: | 0.035 | CYP1A2-substrate: | 0.044 |
| CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.063 |
| CYP2C9-inhibitor: | 0.386 | CYP2C9-substrate: | 0.24 |
| CYP2D6-inhibitor: | 0.238 | CYP2D6-substrate: | 0.098 |
| CYP3A4-inhibitor: | 0.665 | CYP3A4-substrate: | 0.332 |
| Clearance (CL): | 1.849 | Half-life (T1/2): | 0.15 |
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.994 |
| Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.021 |
| Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.07 |
| Skin Sensitization: | 0.035 | Carcinogencity: | 0.017 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.031 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002870 | ![]() |
0.890 | D0T5XN | ![]() |
0.268 | ||
| ENC002105 | ![]() |
0.881 | D07IPB | ![]() |
0.266 | ||
| ENC001991 | ![]() |
0.874 | D0Q0PR | ![]() |
0.260 | ||
| ENC002978 | ![]() |
0.792 | D07VLY | ![]() |
0.258 | ||
| ENC001969 | ![]() |
0.786 | D0C9XJ | ![]() |
0.258 | ||
| ENC004764 | ![]() |
0.721 | D01XDL | ![]() |
0.255 | ||
| ENC001968 | ![]() |
0.701 | D01XWG | ![]() |
0.255 | ||
| ENC005074 | ![]() |
0.663 | D0FX2Q | ![]() |
0.255 | ||
| ENC003646 | ![]() |
0.650 | D0OL7F | ![]() |
0.253 | ||
| ENC005070 | ![]() |
0.605 | D0G3DL | ![]() |
0.243 | ||