|
Name |
Diaporxanthone E
|
| Molecular Formula | C32H32O13 | |
| IUPAC Name* |
[1,8-dihydroxy-5-[5-hydroxy-2-(hydroxymethyl)-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromen-8-yl]-4a-(hydroxymethyl)-3-methyl-9-oxo-3,4-dihydro-2H-xanthen-4-yl]acetate
|
|
| SMILES |
CC(=O)OC1C(C)CC(O)=C2C(=O)c3c(O)ccc(-c4ccc(O)c5c4OC(CO)(C4OC(=O)CC4C)CC5=O)c3OC21CO
|
|
| InChI |
InChI=1S/C32H32O13/c1-13-8-20(38)25-26(41)24-19(37)7-5-17(28(24)45-32(25,12-34)30(13)42-15(3)35)16-4-6-18(36)23-21(39)10-31(11-33,44-27(16)23)29-14(2)9-22(40)43-29/h4-7,13-14,29-30,33-34,36-38H,8-12H2,1-3H3/t13-,14-,29-,30-,31+,32+/m0/s1
|
|
| InChIKey |
GSJLYKVVYVYMCE-ZEMRXHHBSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 624.6 | ALogp: | 2.5 |
| HBD: | 5 | HBA: | 13 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 206.3 | Aromatic Rings: | 6 |
| Heavy Atoms: | 45 | QED Weighted: | 0.303 |
| Caco-2 Permeability: | -5.383 | MDCK Permeability: | 0.00000540 |
| Pgp-inhibitor: | 0.709 | Pgp-substrate: | 0.427 |
| Human Intestinal Absorption (HIA): | 0.656 | 20% Bioavailability (F20%): | 0.041 |
| 30% Bioavailability (F30%): | 0.142 |
| Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 88.57% |
| Volume Distribution (VD): | 0.413 | Fu: | 6.36% |
| CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.083 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.061 |
| CYP2C9-inhibitor: | 0.109 | CYP2C9-substrate: | 0.471 |
| CYP2D6-inhibitor: | 0.076 | CYP2D6-substrate: | 0.13 |
| CYP3A4-inhibitor: | 0.792 | CYP3A4-substrate: | 0.251 |
| Clearance (CL): | 6.615 | Half-life (T1/2): | 0.084 |
| hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.762 |
| Drug-inuced Liver Injury (DILI): | 0.967 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.991 | Maximum Recommended Daily Dose: | 0.293 |
| Skin Sensitization: | 0.036 | Carcinogencity: | 0.047 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.024 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003646 | ![]() |
0.693 | D01XDL | ![]() |
0.285 | ||
| ENC005073 | ![]() |
0.662 | D07VLY | ![]() |
0.279 | ||
| ENC005074 | ![]() |
0.631 | D0C9XJ | ![]() |
0.279 | ||
| ENC002978 | ![]() |
0.572 | D01XWG | ![]() |
0.277 | ||
| ENC005070 | ![]() |
0.561 | D0T5XN | ![]() |
0.269 | ||
| ENC005075 | ![]() |
0.555 | D08FPM | ![]() |
0.265 | ||
| ENC005731 | ![]() |
0.528 | D02GAC | ![]() |
0.257 | ||
| ENC002448 | ![]() |
0.528 | D0AZ8C | ![]() |
0.256 | ||
| ENC002870 | ![]() |
0.517 | D0FX2Q | ![]() |
0.255 | ||
| ENC003348 | ![]() |
0.512 | D01UBX | ![]() |
0.253 | ||