|
Name |
3-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-(2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)-1,4-dihydroxypyridin-2-one
|
| Molecular Formula | C23H29NO7 | |
| IUPAC Name* |
3-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-(2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-2-yl)-1,4-dihydroxypyridin-2-one
|
|
| SMILES |
C[C@H]1C=C[C@H]2CCCC[C@H]2[C@@H]1C(=O)C3=C(C(=CN(C3=O)O)C4(CCC(C5C4O5)O)O)O
|
|
| InChI |
InChI=1S/C23H29NO7/c1-11-6-7-12-4-2-3-5-13(12)16(11)19(27)17-18(26)14(10-24(30)22(17)28)23(29)9-8-15(25)20-21(23)31-20/h6-7,10-13,15-16,20-21,25-26,29-30H,2-5,8-9H2,1H3/t11-,12+,13+,15?,16+,20?,21?,23?/m0/s1
|
|
| InChIKey |
LNTGLCDRWWFPDI-GZSAUYQBSA-N
|
|
| Synonyms |
Fischerin
|
|
| CAS | NA | |
| PubChem CID | 139587915 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 431.5 | ALogp: | 1.3 |
| HBD: | 4 | HBA: | 7 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 131.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 31 | QED Weighted: | 0.25 |
| Caco-2 Permeability: | -5.228 | MDCK Permeability: | 0.00000814 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.107 |
| Human Intestinal Absorption (HIA): | 0.868 | 20% Bioavailability (F20%): | 0.02 |
| 30% Bioavailability (F30%): | 0.044 |
| Blood-Brain-Barrier Penetration (BBB): | 0.647 | Plasma Protein Binding (PPB): | 93.22% |
| Volume Distribution (VD): | 0.689 | Fu: | 5.54% |
| CYP1A2-inhibitor: | 0.04 | CYP1A2-substrate: | 0.591 |
| CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.09 |
| CYP2C9-inhibitor: | 0.073 | CYP2C9-substrate: | 0.442 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.117 |
| CYP3A4-inhibitor: | 0.663 | CYP3A4-substrate: | 0.226 |
| Clearance (CL): | 9.972 | Half-life (T1/2): | 0.077 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.152 |
| Drug-inuced Liver Injury (DILI): | 0.2 | AMES Toxicity: | 0.067 |
| Rat Oral Acute Toxicity: | 0.75 | Maximum Recommended Daily Dose: | 0.575 |
| Skin Sensitization: | 0.073 | Carcinogencity: | 0.546 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.776 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002059 | ![]() |
0.343 | D01KQA | ![]() |
0.260 | ||
| ENC002108 | ![]() |
0.333 | D0D1SG | ![]() |
0.246 | ||
| ENC000866 | ![]() |
0.333 | D03DXN | ![]() |
0.244 | ||
| ENC000978 | ![]() |
0.328 | D08PIQ | ![]() |
0.242 | ||
| ENC003756 | ![]() |
0.327 | D0K7HU | ![]() |
0.242 | ||
| ENC003708 | ![]() |
0.325 | D04SFH | ![]() |
0.242 | ||
| ENC005829 | ![]() |
0.295 | D0U0XD | ![]() |
0.241 | ||
| ENC003771 | ![]() |
0.284 | D0Z1FX | ![]() |
0.239 | ||
| ENC002735 | ![]() |
0.283 | D0KR5B | ![]() |
0.236 | ||
| ENC002822 | ![]() |
0.277 | D0I1LH | ![]() |
0.234 | ||