![]() |
Name |
Solanapyrone A
|
Molecular Formula | C18H22O4 | |
IUPAC Name* |
6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-methoxy-2-oxopyran-3-carbaldehyde
|
|
SMILES |
C[C@H]1C=C[C@H]2CCCC[C@H]2[C@@H]1C3=CC(=C(C(=O)O3)C=O)OC
|
|
InChI |
InChI=1S/C18H22O4/c1-11-7-8-12-5-3-4-6-13(12)17(11)16-9-15(21-2)14(10-19)18(20)22-16/h7-13,17H,3-6H2,1-2H3/t11-,12+,13+,17+/m0/s1
|
|
InChIKey |
AWQLNKJBXASXDU-SFDCBXKLSA-N
|
|
Synonyms |
Solanapyrone A; (-)-Solanapyrone A; 88899-61-0; 4-Methoxy-6-((1R,2S,4aR,8aR)-1,2,4a,5,6,7,8,8a-octahydro-2-methyl-1-naphthalenyl)-2-oxo-2H-pyran-3-carboxaldehyde; 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-methoxy-2-oxopyran-3-carbaldehyde; 4-methoxy-6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-oxo-2H-pyran-3-carbaldehyde; CHEBI:38229; DTXSID101043634; 2H-Pyran-3-carboxaldehyde, 4-methoxy-6-(1,2,4a,5,6,7,8,8a-octahydro-2-methyl-1-naphthalenyl)-2-oxo-, (1R-(1alpha,2beta,4aalpha,8aalpha))-; C20201; Q27117415; 2H-Pyran-3-carboxaldehyde, 4-methoxy-6-((1R,2S,4aR,8aR)-1,2,4a,5,6,7,8,8a-octahydro-2-methyl-1-naphthalenyl)-2-oxo-; 4-Methoxy-6-((1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-2-oxo-2H-pyran-3-carboxaldehyde
|
|
CAS | 88899-61-0 | |
PubChem CID | 119326 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 302.4 | ALogp: | 3.7 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 52.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.617 |
Caco-2 Permeability: | -4.669 | MDCK Permeability: | 0.00002890 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.095 | 20% Bioavailability (F20%): | 0.186 |
30% Bioavailability (F30%): | 0.936 |
Blood-Brain-Barrier Penetration (BBB): | 0.208 | Plasma Protein Binding (PPB): | 94.86% |
Volume Distribution (VD): | 1.768 | Fu: | 4.37% |
CYP1A2-inhibitor: | 0.804 | CYP1A2-substrate: | 0.911 |
CYP2C19-inhibitor: | 0.716 | CYP2C19-substrate: | 0.847 |
CYP2C9-inhibitor: | 0.678 | CYP2C9-substrate: | 0.354 |
CYP2D6-inhibitor: | 0.034 | CYP2D6-substrate: | 0.745 |
CYP3A4-inhibitor: | 0.905 | CYP3A4-substrate: | 0.343 |
Clearance (CL): | 3.411 | Half-life (T1/2): | 0.118 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.164 |
Drug-inuced Liver Injury (DILI): | 0.752 | AMES Toxicity: | 0.053 |
Rat Oral Acute Toxicity: | 0.585 | Maximum Recommended Daily Dose: | 0.366 |
Skin Sensitization: | 0.218 | Carcinogencity: | 0.664 |
Eye Corrosion: | 0.687 | Eye Irritation: | 0.472 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003708 | ![]() |
0.841 | D07GRH | ![]() |
0.238 | ||
ENC002059 | ![]() |
0.779 | D03DIG | ![]() |
0.238 | ||
ENC002108 | ![]() |
0.746 | D0T6RC | ![]() |
0.238 | ||
ENC000978 | ![]() |
0.688 | D0X5KF | ![]() |
0.238 | ||
ENC003756 | ![]() |
0.541 | D0E9CD | ![]() |
0.227 | ||
ENC003771 | ![]() |
0.349 | D0P0RX | ![]() |
0.225 | ||
ENC003767 | ![]() |
0.333 | D09OBB | ![]() |
0.224 | ||
ENC001414 | ![]() |
0.302 | D0R9VR | ![]() |
0.220 | ||
ENC003553 | ![]() |
0.301 | D0K7LU | ![]() |
0.220 | ||
ENC002425 | ![]() |
0.301 | D0D2VS | ![]() |
0.218 |