![]() |
Name |
Mortieridinone
|
Molecular Formula | C29H47NO5 | |
IUPAC Name* |
3-[3-(4,6-dimethyloct-2-en-2-yl)-4-methylcyclohexyl]-4-hydroxy-1-methyl-5-(1,2,4-trihydroxycyclohexyl)pyridin-2-one
|
|
SMILES |
CCC(C)CC(C)C=C(C)C1CC(c2c(O)c(C3(O)CCC(O)CC3O)cn(C)c2=O)CCC1C
|
|
InChI |
InChI=1S/C29H47NO5/c1-7-17(2)12-18(3)13-20(5)23-14-21(9-8-19(23)4)26-27(33)24(16-30(6)28(26)34)29(35)11-10-22(31)15-25(29)32/h13,16-19,21-23,25,31-33,35H,7-12,14-15H2,1-6H3/b20-13+
|
|
InChIKey |
PSKYIWGILKJIDL-DEDYPNTBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 489.7 | ALogp: | 4.7 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 35 | QED Weighted: | 0.397 |
Caco-2 Permeability: | -4.737 | MDCK Permeability: | 0.00001210 |
Pgp-inhibitor: | 0.092 | Pgp-substrate: | 0.794 |
Human Intestinal Absorption (HIA): | 0.275 | 20% Bioavailability (F20%): | 0.277 |
30% Bioavailability (F30%): | 0.024 |
Blood-Brain-Barrier Penetration (BBB): | 0.944 | Plasma Protein Binding (PPB): | 97.53% |
Volume Distribution (VD): | 1.168 | Fu: | 2.60% |
CYP1A2-inhibitor: | 0.028 | CYP1A2-substrate: | 0.909 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.939 |
CYP2C9-inhibitor: | 0.286 | CYP2C9-substrate: | 0.973 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.328 |
CYP3A4-inhibitor: | 0.458 | CYP3A4-substrate: | 0.792 |
Clearance (CL): | 12.381 | Half-life (T1/2): | 0.037 |
hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.619 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.785 | Maximum Recommended Daily Dose: | 0.769 |
Skin Sensitization: | 0.152 | Carcinogencity: | 0.042 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.824 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002822 | ![]() |
0.621 | D0OR2L | ![]() |
0.272 | ||
ENC002361 | ![]() |
0.508 | D03ZTE | ![]() |
0.257 | ||
ENC003476 | ![]() |
0.438 | D0G3SH | ![]() |
0.257 | ||
ENC003004 | ![]() |
0.438 | D0M4WA | ![]() |
0.257 | ||
ENC004957 | ![]() |
0.433 | D0Y7LD | ![]() |
0.255 | ||
ENC002816 | ![]() |
0.371 | D0W2EK | ![]() |
0.253 | ||
ENC004958 | ![]() |
0.363 | D08SVH | ![]() |
0.248 | ||
ENC003767 | ![]() |
0.295 | D05BTM | ![]() |
0.231 | ||
ENC005016 | ![]() |
0.284 | D0G5CF | ![]() |
0.231 | ||
ENC005209 | ![]() |
0.281 | D0N1TP | ![]() |
0.231 |