![]() |
Name |
(-)-Oxysporidinone
|
Molecular Formula | C28H43NO6 | |
IUPAC Name* |
5-[(1R,2S)-1,2-dihydroxy-4-oxocyclohexyl]-3-[(5S)-6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methylpyridin-2-one
|
|
SMILES |
CCC(C)CC(C)/C=C(\C)/C1[C@H](CCC(O1)C2=C(C(=CN(C2=O)C)[C@@]3(CCC(=O)C[C@@H]3O)O)O)C
|
|
InChI |
InChI=1S/C28H43NO6/c1-7-16(2)12-17(3)13-19(5)26-18(4)8-9-22(35-26)24-25(32)21(15-29(6)27(24)33)28(34)11-10-20(30)14-23(28)31/h13,15-18,22-23,26,31-32,34H,7-12,14H2,1-6H3/b19-13+/t16?,17?,18-,22?,23-,26?,28+/m0/s1
|
|
InChIKey |
CYNJYGDSSURTLH-WJNWFAJISA-N
|
|
Synonyms |
(-)-oxysporidinone; CHEMBL220477
|
|
CAS | NA | |
PubChem CID | 54727740 | |
ChEMBL ID | CHEMBL220477 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 489.6 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 35 | QED Weighted: | 0.474 |
Caco-2 Permeability: | -4.714 | MDCK Permeability: | 0.00001690 |
Pgp-inhibitor: | 0.943 | Pgp-substrate: | 0.948 |
Human Intestinal Absorption (HIA): | 0.844 | 20% Bioavailability (F20%): | 0.197 |
30% Bioavailability (F30%): | 0.945 |
Blood-Brain-Barrier Penetration (BBB): | 0.953 | Plasma Protein Binding (PPB): | 92.44% |
Volume Distribution (VD): | 1.471 | Fu: | 3.85% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.821 |
CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.914 |
CYP2C9-inhibitor: | 0.198 | CYP2C9-substrate: | 0.928 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.281 |
CYP3A4-inhibitor: | 0.242 | CYP3A4-substrate: | 0.42 |
Clearance (CL): | 9.641 | Half-life (T1/2): | 0.122 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.632 |
Drug-inuced Liver Injury (DILI): | 0.17 | AMES Toxicity: | 0.087 |
Rat Oral Acute Toxicity: | 0.894 | Maximum Recommended Daily Dose: | 0.956 |
Skin Sensitization: | 0.148 | Carcinogencity: | 0.151 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.94 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002361 | ![]() |
0.781 | D0W2EK | ![]() |
0.262 | ||
ENC005829 | ![]() |
0.621 | D08SVH | ![]() |
0.231 | ||
ENC003476 | ![]() |
0.586 | D0T5XN | ![]() |
0.228 | ||
ENC003004 | ![]() |
0.586 | D04VIS | ![]() |
0.227 | ||
ENC004957 | ![]() |
0.583 | D0L7AS | ![]() |
0.226 | ||
ENC004958 | ![]() |
0.415 | D02IQY | ![]() |
0.224 | ||
ENC002816 | ![]() |
0.361 | D0Y7LD | ![]() |
0.221 | ||
ENC004038 | ![]() |
0.291 | D0I2SD | ![]() |
0.218 | ||
ENC002888 | ![]() |
0.290 | D04SFH | ![]() |
0.218 | ||
ENC005630 | ![]() |
0.290 | D06YFA | ![]() |
0.217 |