![]() |
Name |
Solanapyrone B
|
Molecular Formula | C18H24O4 | |
IUPAC Name* |
6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(hydroxymethyl)-4-methoxypyran-2-one
|
|
SMILES |
C[C@H]1C=C[C@H]2CCCC[C@H]2[C@@H]1C3=CC(=C(C(=O)O3)CO)OC
|
|
InChI |
InChI=1S/C18H24O4/c1-11-7-8-12-5-3-4-6-13(12)17(11)16-9-15(21-2)14(10-19)18(20)22-16/h7-9,11-13,17,19H,3-6,10H2,1-2H3/t11-,12+,13+,17+/m0/s1
|
|
InChIKey |
YJHFAFJKTXEFDR-SFDCBXKLSA-N
|
|
Synonyms |
Solanapyrone B; Solanapyrone E; 3-(hydroxymethyl)-4-methoxy-6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2H-pyran-2-one; CHEBI:38235; Q27117416; 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(hydroxymethyl)-4-methoxypyran-2-one
|
|
CAS | 88899-60-9 | |
PubChem CID | 11098743 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 304.4 | ALogp: | 3.7 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.857 |
Caco-2 Permeability: | -4.792 | MDCK Permeability: | 0.00003690 |
Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0.067 |
Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.05 |
30% Bioavailability (F30%): | 0.937 |
Blood-Brain-Barrier Penetration (BBB): | 0.578 | Plasma Protein Binding (PPB): | 94.01% |
Volume Distribution (VD): | 1.559 | Fu: | 4.49% |
CYP1A2-inhibitor: | 0.668 | CYP1A2-substrate: | 0.939 |
CYP2C19-inhibitor: | 0.49 | CYP2C19-substrate: | 0.842 |
CYP2C9-inhibitor: | 0.512 | CYP2C9-substrate: | 0.349 |
CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.808 |
CYP3A4-inhibitor: | 0.898 | CYP3A4-substrate: | 0.479 |
Clearance (CL): | 6.904 | Half-life (T1/2): | 0.545 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.238 |
Drug-inuced Liver Injury (DILI): | 0.762 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.433 | Maximum Recommended Daily Dose: | 0.074 |
Skin Sensitization: | 0.105 | Carcinogencity: | 0.384 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.078 |
Respiratory Toxicity: | 0.911 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000866 | ![]() |
0.746 | D07GRH | ![]() |
0.253 | ||
ENC003708 | ![]() |
0.671 | D03DIG | ![]() |
0.250 | ||
ENC002059 | ![]() |
0.613 | D0T6RC | ![]() |
0.250 | ||
ENC000978 | ![]() |
0.605 | D0X5KF | ![]() |
0.238 | ||
ENC003756 | ![]() |
0.541 | D05GKD | ![]() |
0.237 | ||
ENC003771 | ![]() |
0.365 | D0R9VR | ![]() |
0.232 | ||
ENC003971 | ![]() |
0.360 | D0U0XD | ![]() |
0.227 | ||
ENC003767 | ![]() |
0.333 | D00ZFP | ![]() |
0.227 | ||
ENC002946 | ![]() |
0.319 | D0P0RX | ![]() |
0.225 | ||
ENC005476 | ![]() |
0.319 | D0D4HN | ![]() |
0.225 |