|
Name |
(4S,8aR,9S,12S,12aR)-9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one
|
| Molecular Formula | C14H24O4 | |
| IUPAC Name* |
(4S,8aR,9S,12S,12aR)-9,12-dihydroxy-4-methyl-1,4,5,6,7,8,8a,9,10,11,12,12a-dodecahydrobenzo[d]oxecin-2-one
|
|
| SMILES |
C[C@H]1CCCC[C@H]2[C@H](CC[C@@H]([C@@H]2CC(=O)O1)O)O
|
|
| InChI |
InChI=1S/C14H24O4/c1-9-4-2-3-5-10-11(8-14(17)18-9)13(16)7-6-12(10)15/h9-13,15-16H,2-8H2,1H3/t9-,10+,11+,12-,13-/m0/s1
|
|
| InChIKey |
VDMSRLJJKGITNQ-QWQWKMKNSA-N
|
|
| Synonyms |
LMA-P1; CHEMBL1761482
|
|
| CAS | NA | |
| PubChem CID | 52917997 | |
| ChEMBL ID | CHEMBL1761482 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 256.34 | ALogp: | 1.6 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 18 | QED Weighted: | 0.652 |
| Caco-2 Permeability: | -4.658 | MDCK Permeability: | 0.00008710 |
| Pgp-inhibitor: | 0.202 | Pgp-substrate: | 0.941 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.498 |
| Blood-Brain-Barrier Penetration (BBB): | 0.259 | Plasma Protein Binding (PPB): | 50.15% |
| Volume Distribution (VD): | 0.712 | Fu: | 26.15% |
| CYP1A2-inhibitor: | 0.035 | CYP1A2-substrate: | 0.095 |
| CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.388 |
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.532 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.104 |
| CYP3A4-inhibitor: | 0.027 | CYP3A4-substrate: | 0.183 |
| Clearance (CL): | 11.59 | Half-life (T1/2): | 0.846 |
| hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.39 |
| Drug-inuced Liver Injury (DILI): | 0.434 | AMES Toxicity: | 0.03 |
| Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.517 |
| Skin Sensitization: | 0.938 | Carcinogencity: | 0.699 |
| Eye Corrosion: | 0.961 | Eye Irritation: | 0.786 |
| Respiratory Toxicity: | 0.688 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002181 | ![]() |
0.524 | D00YWP | ![]() |
0.289 | ||
| ENC002164 | ![]() |
0.524 | D04DJN | ![]() |
0.282 | ||
| ENC001414 | ![]() |
0.493 | D0U3GL | ![]() |
0.276 | ||
| ENC003404 | ![]() |
0.471 | D0K0EK | ![]() |
0.253 | ||
| ENC004377 | ![]() |
0.471 | D06XMU | ![]() |
0.253 | ||
| ENC002200 | ![]() |
0.446 | D0B4RU | ![]() |
0.253 | ||
| ENC002098 | ![]() |
0.446 | D04URO | ![]() |
0.250 | ||
| ENC004121 | ![]() |
0.438 | D0Q6NZ | ![]() |
0.247 | ||
| ENC002063 | ![]() |
0.427 | D0I1LH | ![]() |
0.245 | ||
| ENC004602 | ![]() |
0.395 | D03XOC | ![]() |
0.245 | ||