|
Name |
Lithocarin C
|
| Molecular Formula | C28H40O6 | |
| IUPAC Name* |
[(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (4E,6E)-9-acetyloxy-3-hydroxy-2-methyldeca-4,6-dienoate
|
|
| SMILES |
C[C@H]1[C@@H](CCC2=CC(=O)C(=C(C)C)C[C@]12C)OC(=O)C(C)C(/C=C/C=C/CC(C)OC(=O)C)O
|
|
| InChI |
InChI=1S/C28H40O6/c1-17(2)23-16-28(7)20(5)26(14-13-22(28)15-25(23)31)34-27(32)19(4)24(30)12-10-8-9-11-18(3)33-21(6)29/h8-10,12,15,18-20,24,26,30H,11,13-14,16H2,1-7H3/b9-8+,12-10+/t18?,19?,20-,24?,26+,28+/m0/s1
|
|
| InChIKey |
GTEPJOCJNHDXQV-QYAGHIRVSA-N
|
|
| Synonyms |
Lithocarin C
|
|
| CAS | NA | |
| PubChem CID | 146683443 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 472.6 | ALogp: | 4.9 |
| HBD: | 1 | HBA: | 6 |
| Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 89.9 | Aromatic Rings: | 2 |
| Heavy Atoms: | 34 | QED Weighted: | 0.29 |
| Caco-2 Permeability: | -4.611 | MDCK Permeability: | 0.00001330 |
| Pgp-inhibitor: | 0.945 | Pgp-substrate: | 0.338 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.011 |
| 30% Bioavailability (F30%): | 0.138 |
| Blood-Brain-Barrier Penetration (BBB): | 0.688 | Plasma Protein Binding (PPB): | 80.88% |
| Volume Distribution (VD): | 0.341 | Fu: | 15.09% |
| CYP1A2-inhibitor: | 0.051 | CYP1A2-substrate: | 0.077 |
| CYP2C19-inhibitor: | 0.341 | CYP2C19-substrate: | 0.832 |
| CYP2C9-inhibitor: | 0.26 | CYP2C9-substrate: | 0.968 |
| CYP2D6-inhibitor: | 0.599 | CYP2D6-substrate: | 0.767 |
| CYP3A4-inhibitor: | 0.882 | CYP3A4-substrate: | 0.693 |
| Clearance (CL): | 3.527 | Half-life (T1/2): | 0.411 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.719 |
| Drug-inuced Liver Injury (DILI): | 0.902 | AMES Toxicity: | 0.101 |
| Rat Oral Acute Toxicity: | 0.446 | Maximum Recommended Daily Dose: | 0.1 |
| Skin Sensitization: | 0.864 | Carcinogencity: | 0.845 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.351 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003895 | ![]() |
0.813 | D0X4RS | ![]() |
0.259 | ||
| ENC004127 | ![]() |
0.750 | D02CJX | ![]() |
0.239 | ||
| ENC004660 | ![]() |
0.526 | D02CNR | ![]() |
0.235 | ||
| ENC003665 | ![]() |
0.513 | D0W5LS | ![]() |
0.227 | ||
| ENC000965 | ![]() |
0.354 | D08BDT | ![]() |
0.227 | ||
| ENC002230 | ![]() |
0.330 | D09WYX | ![]() |
0.226 | ||
| ENC003292 | ![]() |
0.314 | D0V2JK | ![]() |
0.222 | ||
| ENC003293 | ![]() |
0.310 | D0FG6M | ![]() |
0.221 | ||
| ENC002137 | ![]() |
0.304 | D08TEJ | ![]() |
0.221 | ||
| ENC003294 | ![]() |
0.295 | D00AEQ | ![]() |
0.221 | ||