![]() |
Name |
6-hydroxy-3-methoxyviridicatin
|
Molecular Formula | C16H13NO3 | |
IUPAC Name* |
6-hydroxy-3-methoxy-4-phenyl-1H-quinolin-2-one
|
|
SMILES |
COc1c(-c2ccccc2)c2cc(O)ccc2[nH]c1=O
|
|
InChI |
InChI=1S/C16H13NO3/c1-20-15-14(10-5-3-2-4-6-10)12-9-11(18)7-8-13(12)17-16(15)19/h2-9,18H,1H3,(H,17,19)
|
|
InChIKey |
ZXMACGSGNRFNQO-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 267.28 | ALogp: | 2.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 62.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.744 |
Caco-2 Permeability: | -4.953 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.108 | Plasma Protein Binding (PPB): | 95.82% |
Volume Distribution (VD): | 0.449 | Fu: | 1.83% |
CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.756 |
CYP2C19-inhibitor: | 0.685 | CYP2C19-substrate: | 0.069 |
CYP2C9-inhibitor: | 0.42 | CYP2C9-substrate: | 0.904 |
CYP2D6-inhibitor: | 0.426 | CYP2D6-substrate: | 0.599 |
CYP3A4-inhibitor: | 0.682 | CYP3A4-substrate: | 0.21 |
Clearance (CL): | 6.165 | Half-life (T1/2): | 0.791 |
hERG Blockers: | 0.126 | Human Hepatotoxicity (H-HT): | 0.053 |
Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.668 |
Rat Oral Acute Toxicity: | 0.059 | Maximum Recommended Daily Dose: | 0.149 |
Skin Sensitization: | 0.285 | Carcinogencity: | 0.371 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.655 |
Respiratory Toxicity: | 0.82 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005446 | ![]() |
0.781 | D0R2OA | ![]() |
0.393 | ||
ENC001109 | ![]() |
0.723 | D09LDR | ![]() |
0.390 | ||
ENC003390 | ![]() |
0.701 | D04BNP | ![]() |
0.381 | ||
ENC000858 | ![]() |
0.586 | D0J6WW | ![]() |
0.381 | ||
ENC003571 | ![]() |
0.577 | D07JVL | ![]() |
0.373 | ||
ENC003482 | ![]() |
0.500 | D0A1PX | ![]() |
0.372 | ||
ENC002858 | ![]() |
0.488 | D0P3JU | ![]() |
0.368 | ||
ENC005037 | ![]() |
0.471 | D0T5WK | ![]() |
0.360 | ||
ENC002969 | ![]() |
0.432 | D0L6DA | ![]() |
0.352 | ||
ENC002759 | ![]() |
0.427 | D0J1MI | ![]() |
0.348 |