|
Name |
Hexahydropyridine, 1-methyl-4-[4,5-dihydroxyphenyl]-
|
| Molecular Formula | C12H17NO2 | |
| IUPAC Name* |
4-(1-methylpiperidin-4-yl)benzene-1,2-diol
|
|
| SMILES |
CN1CCC(CC1)C2=CC(=C(C=C2)O)O
|
|
| InChI |
InChI=1S/C12H17NO2/c1-13-6-4-9(5-7-13)10-2-3-11(14)12(15)8-10/h2-3,8-9,14-15H,4-7H2,1H3
|
|
| InChIKey |
JKYGPAJMFOJYKA-UHFFFAOYSA-N
|
|
| Synonyms |
CHEMBL321432; 94427-47-1; 1,2-benzenediol,4-(1-methyl-4-piperidinyl)-; SCHEMBL8381137; BDBM50025880; ZINC26943585; 4-(1-Methyl-4-piperidinyl)-1,2-benzenediol #; 4-(1-Methyl-piperidin-4-yl)-benzene-1,2-diol; Hexahydropyridine, 1-methyl-4-[4,5-dihydroxyphenyl]-
|
|
| CAS | NA | |
| PubChem CID | 610035 | |
| ChEMBL ID | CHEMBL321432 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 207.27 | ALogp: | 1.6 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 43.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.695 |
| Caco-2 Permeability: | -4.593 | MDCK Permeability: | 0.00000811 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.972 |
| Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.947 |
| 30% Bioavailability (F30%): | 0.808 |
| Blood-Brain-Barrier Penetration (BBB): | 0.98 | Plasma Protein Binding (PPB): | 34.25% |
| Volume Distribution (VD): | 1.863 | Fu: | 60.98% |
| CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.829 |
| CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.725 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.283 |
| CYP2D6-inhibitor: | 0.158 | CYP2D6-substrate: | 0.901 |
| CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.311 |
| Clearance (CL): | 18.078 | Half-life (T1/2): | 0.797 |
| hERG Blockers: | 0.115 | Human Hepatotoxicity (H-HT): | 0.25 |
| Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.254 |
| Rat Oral Acute Toxicity: | 0.697 | Maximum Recommended Daily Dose: | 0.824 |
| Skin Sensitization: | 0.95 | Carcinogencity: | 0.143 |
| Eye Corrosion: | 0.066 | Eye Irritation: | 0.062 |
| Respiratory Toxicity: | 0.928 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000329 | ![]() |
0.404 | D0T3KI | ![]() |
0.354 | ||
| ENC000002 | ![]() |
0.340 | D0T7OW | ![]() |
0.333 | ||
| ENC000895 | ![]() |
0.333 | D04PHC | ![]() |
0.328 | ||
| ENC002095 | ![]() |
0.328 | D07MOX | ![]() |
0.321 | ||
| ENC000035 | ![]() |
0.321 | D0BA6T | ![]() |
0.306 | ||
| ENC001440 | ![]() |
0.305 | D0V9EN | ![]() |
0.305 | ||
| ENC000699 | ![]() |
0.299 | D0I8FI | ![]() |
0.302 | ||
| ENC000320 | ![]() |
0.299 | D0U0OT | ![]() |
0.302 | ||
| ENC001068 | ![]() |
0.299 | D03XES | ![]() |
0.300 | ||
| ENC000127 | ![]() |
0.295 | D08HVR | ![]() |
0.295 | ||