![]() |
Name |
Eriodictyol
|
Molecular Formula | C15H12O6 | |
IUPAC Name* |
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one
|
|
SMILES |
C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O
|
|
InChI |
InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1
|
|
InChIKey |
SBHXYTNGIZCORC-ZDUSSCGKSA-N
|
|
Synonyms |
ERIODICTYOL; 552-58-9; Eriodictiol; (+)-Eriodictyol; (S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4-benzopyrone; (S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychroman-4-one; (S)-Eriodictyol; CHEMBL8996; Huazhongilexone; (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one; CHEBI:28412; (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one; Q520486B8Y; (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-4-one; eriodicryol; eryodictiol; UNII-Q520486B8Y; NSC-649412; EINECS 209-016-4; NSC 649412; Eriodictyol - 98%; Eriodictyol with HPLC; ERIODICTYOL [MI]; ERIODICTYOL [INCI]; SCHEMBL19180; Eriodictyol, analytical standard; ZINC58117; DTXSID70877706; 3' 4' 5 7-tetrahydroxyflavanone; 5,7,3'',4''-tetrahydroxyflavon; BCP13401; HY-N0637; Eriodictyol, >=95.0% (HPLC); BDBM50325671; LMPK12140002; MFCD00135890; s9123; 5,7,3'',4''-tetrahydroxyflavanone; AKOS025311577; AC-6043; CCG-267356; (2S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one; (S)-3',4',5,7-Tetrahydroxyflavanone; AS-72316; CS-0009666; C05631; 552E589; A830557; EN300-18546823; Q-100627; Q3459685; (S)-2-(3,4-Dihydroxy-phenyl)-5,7-dihydroxy-chroman-4-one; (S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one
|
|
CAS | 552-58-9 | |
PubChem CID | 440735 | |
ChEMBL ID | CHEMBL8996 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 288.25 | ALogp: | 2.0 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.601 |
Caco-2 Permeability: | -5.042 | MDCK Permeability: | 0.00000869 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.794 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.025 | Plasma Protein Binding (PPB): | 91.26% |
Volume Distribution (VD): | 0.647 | Fu: | 9.67% |
CYP1A2-inhibitor: | 0.868 | CYP1A2-substrate: | 0.274 |
CYP2C19-inhibitor: | 0.275 | CYP2C19-substrate: | 0.051 |
CYP2C9-inhibitor: | 0.699 | CYP2C9-substrate: | 0.877 |
CYP2D6-inhibitor: | 0.532 | CYP2D6-substrate: | 0.463 |
CYP3A4-inhibitor: | 0.689 | CYP3A4-substrate: | 0.148 |
Clearance (CL): | 20.377 | Half-life (T1/2): | 0.84 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.177 |
Drug-inuced Liver Injury (DILI): | 0.955 | AMES Toxicity: | 0.517 |
Rat Oral Acute Toxicity: | 0.797 | Maximum Recommended Daily Dose: | 0.414 |
Skin Sensitization: | 0.948 | Carcinogencity: | 0.509 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.949 |
Respiratory Toxicity: | 0.729 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000700 | ![]() |
0.776 | D07MGA | ![]() |
0.776 | ||
ENC001438 | ![]() |
0.701 | D04AIT | ![]() |
0.487 | ||
ENC000320 | ![]() |
0.611 | D0K8KX | ![]() |
0.475 | ||
ENC000699 | ![]() |
0.611 | D0AZ8C | ![]() |
0.381 | ||
ENC001534 | ![]() |
0.487 | D0I9HF | ![]() |
0.375 | ||
ENC001529 | ![]() |
0.475 | D0U3YB | ![]() |
0.326 | ||
ENC004203 | ![]() |
0.468 | D0R6BI | ![]() |
0.300 | ||
ENC004389 | ![]() |
0.429 | D02FCQ | ![]() |
0.283 | ||
ENC000940 | ![]() |
0.415 | D0I3RO | ![]() |
0.276 | ||
ENC005853 | ![]() |
0.400 | D0V9EN | ![]() |
0.274 |