|
Name |
Fengycin
|
| Molecular Formula | C72H110N12O20 | |
| IUPAC Name* |
(4S)-5-[[(2R)-5-amino-1-[[(4S,7S,10S,13S,19R,22S,25S,28R)-10-(3-amino-3-oxopropyl)-4-[(2R)-butan-2-yl]-22-(2-carboxyethyl)-25-[(1S)-1-hydroxyethyl]-7-[(4-hydroxyphenyl)methyl]-19-methyl-3,6,9,12,18,21,24,27-octaoxo-2-oxa-5,8,11,17,20,23,26-heptazatricyclo[28.2.2.013,17]tetratriaconta-1(33),30(34),31-trien-28-yl]amino]-1-oxopentan-2-yl]amino]-4-(3-hydroxyhexadecanoylamino)-5-oxopentanoic acid
|
|
| SMILES |
CCCCCCCCCCCCCC(CC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](CCCN)C(=O)N[C@@H]1CC2=CC=C(C=C2)OC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]3CCCN3C(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)[C@H](C)O)CCC(=O)O)C)CCC(=O)N)CC4=CC=C(C=C4)O)[C@H](C)CC)O
|
|
| InChI |
InChI=1S/C72H110N12O20/c1-6-8-9-10-11-12-13-14-15-16-17-20-48(87)41-58(89)76-51(32-35-59(90)91)65(96)77-50(21-18-37-73)64(95)80-55-40-46-25-29-49(30-26-46)104-72(103)61(42(3)7-2)82-67(98)54(39-45-23-27-47(86)28-24-45)81-66(97)52(31-34-57(74)88)78-69(100)56-22-19-38-84(56)71(102)43(4)75-63(94)53(33-36-60(92)93)79-70(101)62(44(5)85)83-68(55)99/h23-30,42-44,48,50-56,61-62,85-87H,6-22,31-41,73H2,1-5H3,(H2,74,88)(H,75,94)(H,76,89)(H,77,96)(H,78,100)(H,79,101)(H,80,95)(H,81,97)(H,82,98)(H,83,99)(H,90,91)(H,92,93)/t42-,43-,44+,48?,50-,51+,52+,53+,54+,55-,56+,61+,62+/m1/s1
|
|
| InChIKey |
CUOJDWBMJMRDHN-RLLVTFBRSA-N
|
|
| Synonyms |
Fengycin; 102577-03-7; Fengycin C; Fengymycin; CHEBI:29583; Q27110158
|
|
| CAS | 102577-03-7 | |
| PubChem CID | 443591 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1463.7 | ALogp: | 2.5 |
| HBD: | 16 | HBA: | 21 |
| Rotatable Bonds: | 36 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 513.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 104 | QED Weighted: | 0.02 |
| Caco-2 Permeability: | -6.099 | MDCK Permeability: | 0.00000409 |
| Pgp-inhibitor: | 0.398 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.999 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 77.03% |
| Volume Distribution (VD): | 0.441 | Fu: | 6.99% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0 |
| CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.016 |
| CYP2C9-inhibitor: | 0.112 | CYP2C9-substrate: | 0.222 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.021 |
| CYP3A4-inhibitor: | 0.088 | CYP3A4-substrate: | 0 |
| Clearance (CL): | 1.075 | Half-life (T1/2): | 0.828 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.918 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.354 | Maximum Recommended Daily Dose: | 0.983 |
| Skin Sensitization: | 0.044 | Carcinogencity: | 0.057 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.001 |
| Respiratory Toxicity: | 0.018 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001506 | ![]() |
0.509 | D09OOV | ![]() |
0.444 | ||
| ENC003684 | ![]() |
0.500 | D05HPI | ![]() |
0.436 | ||
| ENC002094 | ![]() |
0.483 | D0M1IO | ![]() |
0.433 | ||
| ENC001950 | ![]() |
0.482 | D06TFE | ![]() |
0.431 | ||
| ENC003283 | ![]() |
0.472 | D06WKA | ![]() |
0.402 | ||
| ENC003716 | ![]() |
0.472 | D0P4VX | ![]() |
0.401 | ||
| ENC003171 | ![]() |
0.470 | D00GNJ | ![]() |
0.400 | ||
| ENC005271 | ![]() |
0.468 | D0M3FJ | ![]() |
0.399 | ||
| ENC003247 | ![]() |
0.465 | D09PZZ | ![]() |
0.394 | ||
| ENC003950 | ![]() |
0.465 | D0K7NQ | ![]() |
0.393 | ||