|
Name |
Fusaricidin D
|
| Molecular Formula | C46H76N10O12 | |
| IUPAC Name* |
N-[(3R,6R,9R,15R,18S)-6-(3-amino-3-oxopropyl)-9-[(1S)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-3,19-dimethyl-2,5,8,11,14,17-hexaoxo-15-propan-2-yl-1-oxa-4,7,10,13,16-pentazacyclononadec-18-yl]-15-(diaminomethylideneamino)-3-hydroxypentadecanamide
|
|
| SMILES |
C[C@@H]1C(=O)OC([C@@H](C(=O)N[C@@H](C(=O)NC(C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N1)CCC(=O)N)[C@H](C)O)CC2=CC=C(C=C2)O)C(C)C)NC(=O)CC(CCCCCCCCCCCCN=C(N)N)O)C
|
|
| InChI |
InChI=1S/C46H76N10O12/c1-26(2)37-42(64)53-34(24-30-17-19-31(58)20-18-30)41(63)56-38(28(4)57)43(65)52-33(21-22-35(47)60)40(62)51-27(3)45(67)68-29(5)39(44(66)55-37)54-36(61)25-32(59)16-14-12-10-8-6-7-9-11-13-15-23-50-46(48)49/h17-20,26-29,32-34,37-39,57-59H,6-16,21-25H2,1-5H3,(H2,47,60)(H,51,62)(H,52,65)(H,53,64)(H,54,61)(H,55,66)(H,56,63)(H4,48,49,50)/t27-,28+,29?,32?,33-,34?,37-,38-,39+/m1/s1
|
|
| InChIKey |
HCNCOYXCNMBDQH-VUSFZIELSA-N
|
|
| Synonyms |
Fusaricidin D
|
|
| CAS | NA | |
| PubChem CID | 139586203 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 961.2 | ALogp: | 2.9 |
| HBD: | 12 | HBA: | 13 |
| Rotatable Bonds: | 23 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 369.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 68 | QED Weighted: | 0.029 |
| Caco-2 Permeability: | -5.888 | MDCK Permeability: | 0.00002570 |
| Pgp-inhibitor: | 0.153 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.899 | 20% Bioavailability (F20%): | 0.999 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.035 | Plasma Protein Binding (PPB): | 71.15% |
| Volume Distribution (VD): | 0.348 | Fu: | 23.49% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.008 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.032 |
| CYP2C9-inhibitor: | 0.068 | CYP2C9-substrate: | 0.007 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.055 |
| CYP3A4-inhibitor: | 0.164 | CYP3A4-substrate: | 0.023 |
| Clearance (CL): | 2.536 | Half-life (T1/2): | 0.421 |
| hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.945 |
| Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.694 |
| Skin Sensitization: | 0.04 | Carcinogencity: | 0.006 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
| Respiratory Toxicity: | 0.004 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003716 | ![]() |
0.942 | D02SBQ | ![]() |
0.419 | ||
| ENC002057 | ![]() |
0.806 | D0M3FJ | ![]() |
0.409 | ||
| ENC002406 | ![]() |
0.755 | D08FJL | ![]() |
0.383 | ||
| ENC005275 | ![]() |
0.634 | D00ZCN | ![]() |
0.381 | ||
| ENC005273 | ![]() |
0.604 | D0N4OW | ![]() |
0.380 | ||
| ENC005274 | ![]() |
0.589 | D0D8XY | ![]() |
0.379 | ||
| ENC003950 | ![]() |
0.588 | D09OOV | ![]() |
0.374 | ||
| ENC005271 | ![]() |
0.573 | D0U7SH | ![]() |
0.373 | ||
| ENC005272 | ![]() |
0.557 | D0M2YE | ![]() |
0.370 | ||
| ENC005276 | ![]() |
0.531 | D06TFE | ![]() |
0.368 | ||