|
Name |
Mojavensin A
|
| Molecular Formula | C50H77N13O14 | |
| IUPAC Name* |
3-[(3S,6S,9R,12R,19S,22S,25S)-6,12,19,22-tetrakis(2-amino-2-oxoethyl)-9-[(4-hydroxyphenyl)methyl]-16-(9-methylundecyl)-2,5,8,11,14,18,21,24-octaoxo-1,4,7,10,13,17,20,23-octazabicyclo[23.3.0]octacosan-3-yl]propanamide
|
|
| SMILES |
CCC(C)CCCCCCCCC1CC(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC(=O)N)CC(=O)N)CCC(=O)N)CC(=O)N)CC3=CC=C(C=C3)O)CC(=O)N
|
|
| InChI |
InChI=1S/C50H77N13O14/c1-3-27(2)11-8-6-4-5-7-9-12-29-22-43(70)57-33(23-39(52)66)46(73)59-32(21-28-14-16-30(64)17-15-28)45(72)61-35(25-41(54)68)47(74)58-31(18-19-38(51)65)50(77)63-20-10-13-37(63)49(76)62-36(26-42(55)69)48(75)60-34(24-40(53)67)44(71)56-29/h14-17,27,29,31-37,64H,3-13,18-26H2,1-2H3,(H2,51,65)(H2,52,66)(H2,53,67)(H2,54,68)(H2,55,69)(H,56,71)(H,57,70)(H,58,74)(H,59,73)(H,60,75)(H,61,72)(H,62,76)/t27?,29?,31-,32+,33+,34-,35-,36-,37-/m0/s1
|
|
| InChIKey |
CMYBONFRMPHHAP-IRSDMODVSA-N
|
|
| Synonyms |
Mojavensin A
|
|
| CAS | NA | |
| PubChem CID | 102599619 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1084.2 | ALogp: | -2.3 |
| HBD: | 13 | HBA: | 14 |
| Rotatable Bonds: | 23 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 460.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 77 | QED Weighted: | 0.049 |
| Caco-2 Permeability: | -4.908 | MDCK Permeability: | 0.00004660 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.999 |
| Human Intestinal Absorption (HIA): | 0.058 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 34.27% |
| Volume Distribution (VD): | 0.499 | Fu: | 42.61% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.001 |
| CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.013 |
| CYP2C9-inhibitor: | 0.125 | CYP2C9-substrate: | 0.023 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.013 |
| CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.003 |
| Clearance (CL): | 1.365 | Half-life (T1/2): | 0.186 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.345 |
| Drug-inuced Liver Injury (DILI): | 0.007 | AMES Toxicity: | 0.012 |
| Rat Oral Acute Toxicity: | 0.853 | Maximum Recommended Daily Dose: | 0.933 |
| Skin Sensitization: | 0.09 | Carcinogencity: | 0.414 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.001 |
| Respiratory Toxicity: | 0.033 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003171 | ![]() |
0.930 | D09PZZ | ![]() |
0.477 | ||
| ENC003247 | ![]() |
0.881 | D0M3FJ | ![]() |
0.465 | ||
| ENC002094 | ![]() |
0.866 | D0N4OW | ![]() |
0.463 | ||
| ENC001950 | ![]() |
0.852 | D0U7SH | ![]() |
0.461 | ||
| ENC001506 | ![]() |
0.721 | D0P4VX | ![]() |
0.450 | ||
| ENC005271 | ![]() |
0.486 | D0H3MG | ![]() |
0.434 | ||
| ENC001088 | ![]() |
0.472 | D08FJL | ![]() |
0.413 | ||
| ENC005273 | ![]() |
0.465 | D09OOV | ![]() |
0.405 | ||
| ENC005275 | ![]() |
0.454 | D02SBQ | ![]() |
0.401 | ||
| ENC005274 | ![]() |
0.449 | D0D8XY | ![]() |
0.389 | ||