|
Name |
Iturin A
|
| Molecular Formula | C48H74N12O14 | |
| IUPAC Name* |
3-[(3S,6R,9R,12S,19S,22R,25S)-6,12,22-tris(2-amino-2-oxoethyl)-19-(hydroxymethyl)-9-[(4-hydroxyphenyl)methyl]-16-(9-methyldecyl)-2,5,8,11,14,18,21,24-octaoxo-1,4,7,10,13,17,20,23-octazabicyclo[23.3.0]octacosan-3-yl]propanamide
|
|
| SMILES |
CC(C)CCCCCCCCC1CC(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@H](C(=O)N1)CO)CC(=O)N)CCC(=O)N)CC(=O)N)CC3=CC=C(C=C3)O)CC(=O)N
|
|
| InChI |
InChI=1S/C48H74N12O14/c1-26(2)10-7-5-3-4-6-8-11-28-21-41(67)54-32(22-38(50)64)43(69)56-31(20-27-13-15-29(62)16-14-27)42(68)57-33(23-39(51)65)44(70)55-30(17-18-37(49)63)48(74)60-19-9-12-36(60)47(73)58-34(24-40(52)66)45(71)59-35(25-61)46(72)53-28/h13-16,26,28,30-36,61-62H,3-12,17-25H2,1-2H3,(H2,49,63)(H2,50,64)(H2,51,65)(H2,52,66)(H,53,72)(H,54,67)(H,55,70)(H,56,69)(H,57,68)(H,58,73)(H,59,71)/t28?,30-,31+,32-,33+,34+,35-,36-/m0/s1
|
|
| InChIKey |
RDUGMXONDQDIRN-QZBZMMCASA-N
|
|
| Synonyms |
Iturin A
|
|
| CAS | NA | |
| PubChem CID | 102287549 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1043.2 | ALogp: | -1.8 |
| HBD: | 13 | HBA: | 14 |
| Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 437.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 74 | QED Weighted: | 0.053 |
| Caco-2 Permeability: | -5.393 | MDCK Permeability: | 0.00004320 |
| Pgp-inhibitor: | 0.026 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.482 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 49.09% |
| Volume Distribution (VD): | 0.383 | Fu: | 37.92% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.001 |
| CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.017 |
| CYP2C9-inhibitor: | 0.111 | CYP2C9-substrate: | 0.039 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.013 |
| CYP3A4-inhibitor: | 0.046 | CYP3A4-substrate: | 0.004 |
| Clearance (CL): | 1.229 | Half-life (T1/2): | 0.19 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.536 |
| Drug-inuced Liver Injury (DILI): | 0.013 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.657 | Maximum Recommended Daily Dose: | 0.195 |
| Skin Sensitization: | 0.076 | Carcinogencity: | 0.054 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
| Respiratory Toxicity: | 0.002 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002094 | ![]() |
0.971 | D09PZZ | ![]() |
0.474 | ||
| ENC003171 | ![]() |
0.947 | D0M3FJ | ![]() |
0.468 | ||
| ENC001950 | ![]() |
0.910 | D0N4OW | ![]() |
0.456 | ||
| ENC003283 | ![]() |
0.881 | D0U7SH | ![]() |
0.454 | ||
| ENC001506 | ![]() |
0.778 | D0P4VX | ![]() |
0.442 | ||
| ENC005271 | ![]() |
0.527 | D0H3MG | ![]() |
0.431 | ||
| ENC005273 | ![]() |
0.492 | D08FJL | ![]() |
0.415 | ||
| ENC005275 | ![]() |
0.474 | D02SBQ | ![]() |
0.408 | ||
| ENC001088 | ![]() |
0.465 | D0J7XL | ![]() |
0.403 | ||
| ENC005274 | ![]() |
0.463 | D09OOV | ![]() |
0.389 | ||