|
Name |
acuminatum E
|
| Molecular Formula | C44H71N7O11 | |
| IUPAC Name* |
3-[3-butan-2-yl-22-dodecan-2-yl-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-12,15-dimethyl-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,18-hexazacyclodocos-9-yl]propanamide
|
|
| SMILES |
CCCCCCCCCCC(C)C1CC(=O)NC(CO)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(C)CC)C(=O)O1
|
|
| InChI |
InChI=1S/C44H71N7O11/c1-7-9-10-11-12-13-14-15-16-27(4)35-24-37(55)48-34(25-52)43(60)47-28(5)39(56)46-29(6)40(57)49-32(21-22-36(45)54)41(58)50-33(23-30-17-19-31(53)20-18-30)42(59)51-38(26(3)8-2)44(61)62-35/h17-20,26-29,32-35,38,52-53H,7-16,21-25H2,1-6H3,(H2,45,54)(H,46,56)(H,47,60)(H,48,55)(H,49,57)(H,50,58)(H,51,59)/t26-,27+,28-,29+,32-,33+,34+,35-,38-/m0/s1
|
|
| InChIKey |
CTVPNAKLCWVKIP-ZJTOALGOSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 874.09 | ALogp: | 1.7 |
| HBD: | 9 | HBA: | 11 |
| Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 284.4 | Aromatic Rings: | 2 |
| Heavy Atoms: | 62 | QED Weighted: | 0.076 |
| Caco-2 Permeability: | -5.686 | MDCK Permeability: | 0.00004850 |
| Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.963 |
| Human Intestinal Absorption (HIA): | 0.905 | 20% Bioavailability (F20%): | 0.98 |
| 30% Bioavailability (F30%): | 0.998 |
| Blood-Brain-Barrier Penetration (BBB): | 0.011 | Plasma Protein Binding (PPB): | 64.20% |
| Volume Distribution (VD): | 0.351 | Fu: | 14.49% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.019 |
| CYP2C19-inhibitor: | 0.039 | CYP2C19-substrate: | 0.043 |
| CYP2C9-inhibitor: | 0.158 | CYP2C9-substrate: | 0.041 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.044 |
| CYP3A4-inhibitor: | 0.701 | CYP3A4-substrate: | 0.077 |
| Clearance (CL): | 2.144 | Half-life (T1/2): | 0.544 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.75 |
| Drug-inuced Liver Injury (DILI): | 0.019 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.224 |
| Skin Sensitization: | 0.046 | Carcinogencity: | 0.008 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
| Respiratory Toxicity: | 0.005 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005275 | ![]() |
0.842 | D0M3FJ | ![]() |
0.418 | ||
| ENC005276 | ![]() |
0.837 | D02SBQ | ![]() |
0.383 | ||
| ENC003950 | ![]() |
0.834 | D08FJL | ![]() |
0.380 | ||
| ENC005273 | ![]() |
0.828 | D05HPI | ![]() |
0.365 | ||
| ENC005272 | ![]() |
0.800 | D0D8XY | ![]() |
0.365 | ||
| ENC005274 | ![]() |
0.789 | D09PZZ | ![]() |
0.364 | ||
| ENC003684 | ![]() |
0.573 | D09OOV | ![]() |
0.353 | ||
| ENC001506 | ![]() |
0.545 | D00ZCN | ![]() |
0.349 | ||
| ENC003716 | ![]() |
0.539 | D0M2YE | ![]() |
0.347 | ||
| ENC003247 | ![]() |
0.527 | D0U7SH | ![]() |
0.345 | ||