|
Name |
Fusaricidin C
|
| Molecular Formula | C45H74N10O12 | |
| IUPAC Name* |
N-[(3R,6R,9R,15R,18S)-6-(2-amino-2-oxoethyl)-9-[(1S)-1-hydroxyethyl]-12-[(4-hydroxyphenyl)methyl]-3,19-dimethyl-2,5,8,11,14,17-hexaoxo-15-propan-2-yl-1-oxa-4,7,10,13,16-pentazacyclononadec-18-yl]-15-(diaminomethylideneamino)-3-hydroxypentadecanamide
|
|
| SMILES |
C[C@@H]1C(=O)OC([C@@H](C(=O)N[C@@H](C(=O)NC(C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N1)CC(=O)N)[C@H](C)O)CC2=CC=C(C=C2)O)C(C)C)NC(=O)CC(CCCCCCCCCCCCN=C(N)N)O)C
|
|
| InChI |
InChI=1S/C45H74N10O12/c1-25(2)36-41(63)51-32(22-29-17-19-30(57)20-18-29)40(62)55-37(27(4)56)42(64)52-33(24-34(46)59)39(61)50-26(3)44(66)67-28(5)38(43(65)54-36)53-35(60)23-31(58)16-14-12-10-8-6-7-9-11-13-15-21-49-45(47)48/h17-20,25-28,31-33,36-38,56-58H,6-16,21-24H2,1-5H3,(H2,46,59)(H,50,61)(H,51,63)(H,52,64)(H,53,60)(H,54,65)(H,55,62)(H4,47,48,49)/t26-,27+,28?,31?,32?,33-,36-,37-,38+/m1/s1
|
|
| InChIKey |
ZDWHXIUKVAAEQR-JWHDTRKBSA-N
|
|
| Synonyms |
Fusaricidin C
|
|
| CAS | NA | |
| PubChem CID | 139586954 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 947.1 | ALogp: | 2.6 |
| HBD: | 12 | HBA: | 13 |
| Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 369.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 67 | QED Weighted: | 0.03 |
| Caco-2 Permeability: | -5.89 | MDCK Permeability: | 0.00002340 |
| Pgp-inhibitor: | 0.071 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.88 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.042 | Plasma Protein Binding (PPB): | 67.09% |
| Volume Distribution (VD): | 0.333 | Fu: | 28.31% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.008 |
| CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.034 |
| CYP2C9-inhibitor: | 0.066 | CYP2C9-substrate: | 0.007 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.055 |
| CYP3A4-inhibitor: | 0.18 | CYP3A4-substrate: | 0.028 |
| Clearance (CL): | 2.54 | Half-life (T1/2): | 0.398 |
| hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.941 |
| Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.699 |
| Skin Sensitization: | 0.039 | Carcinogencity: | 0.009 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
| Respiratory Toxicity: | 0.004 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003684 | ![]() |
0.942 | D02SBQ | ![]() |
0.446 | ||
| ENC002406 | ![]() |
0.803 | D0D8XY | ![]() |
0.405 | ||
| ENC002057 | ![]() |
0.764 | D0M3FJ | ![]() |
0.403 | ||
| ENC005275 | ![]() |
0.598 | D00ZCN | ![]() |
0.380 | ||
| ENC005273 | ![]() |
0.569 | D08FJL | ![]() |
0.377 | ||
| ENC005274 | ![]() |
0.555 | D0N4OW | ![]() |
0.375 | ||
| ENC003950 | ![]() |
0.555 | D0U7SH | ![]() |
0.367 | ||
| ENC005271 | ![]() |
0.539 | D0M2YE | ![]() |
0.364 | ||
| ENC005272 | ![]() |
0.524 | D09PZZ | ![]() |
0.362 | ||
| ENC005276 | ![]() |
0.498 | D09OOV | ![]() |
0.360 | ||